MiMeDB: Showing metabocard for Deoxycholylglutamine (MMDBc0057274)

Microbial

Human

Co-metabolite

Record Information

Version

2.0

Status

Detected and Quantified

Creation Date

2022-11-10 23:39:57 UTC

Update Date

2024-04-30 20:57:18 UTC

Metabolite ID

MMDBc0057274

Metabolite Identification

Common Name

Deoxycholylglutamine

Description

Deoxycholylglutamine belongs to a class of molecules known as bile acid-amino acid conjugates. These are bile acid conjugates that consist of a primary bile acid such as cholic acid, doxycholic acid and chenodeoxycholic acid, conjugated to an amino acid. Deoxycholylglutamine consists of the bile acid deoxycholic acid conjugated to the amino acid Glutamine conjugated at the C24 acyl site.Bile acids play an important role in regulating various physiological systems, such as fat digestion, cholesterol metabolism, vitamin absorption, liver function, and enterohepatic circulation through their combined signaling, detergent, and antimicrobial mechanisms (PMID: 34127070 ). Bile acids also act as detergents in the gut and support the absorption of fats through the intestinal membrane. These same properties allow for the disruption of bacterial membranes, thereby allowing them to serve a bacteriocidal or bacteriostatic function. In humans (and other mammals) bile acids are normally conjugated with the amino acids glycine and taurine by the liver. This conjugation catalyzed by two liver enzymes, bile acid CoA ligase (BAL) and bile acid CoA: amino acid N-acyltransferase (BAT). Glycine and taurine bound BAs are also referred to as bile salts due to their decreased pKa and complete ionization resulting in these compounds being present as anions in vivo. Unlike glycine and taurine-conjugated bile acids, these recently discovered bile acids, such as Deoxycholylglutamine, are produced by the gut microbiota, making them secondary bile acids (PMID: 32103176 ) or microbially conjugated bile acids (MCBAs) (PMID: 34127070 ). Evidence suggests that these bile acid-amino acid conjugates are produced by microbes belonging to Clostridia species (PMID: 32103176 ). These unusual bile acid-amino acid conjugates are found in higher frequency in patients with inflammatory bowel disease (IBD), cystic fibrosis (CF) and in infants (PMID: 32103176 ). Deoxycholylglutamine appears to act as an agonist for the farnesoid X receptor (FXR) and it can also lead to reduced expression of bile acid synthesis genes (PMID: 32103176 ). It currently appears that microbially conjugated bile acids (MCBAs) or amino acid-bile acid conjugates are only conjugated to cholic acid, deoxycholic acid and chenodeoxycholic acid (PMID: 34127070 ). It has been estimated that if microbial conjugation of bile acids is very promiscuous and occurs for all potential oxidized, epimerized, and dehydroxylated states of each hydroxyl group present on cholic acid (C3, C7, C12) in addition to ring orientation, the total number of potential human bile acid conjugates could be over 2800 (PMID: 34127070 ).

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI


  Mrv1652308312101052D          

 37 40  0  0  0  0            999 V2000
    9.7140   -2.9718    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.4284   -3.3843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4284   -4.2093    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.1429   -2.9718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8574   -3.3843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5719   -2.9718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2863   -3.3843    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.0008   -2.9718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0008   -2.1468    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7153   -3.3843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4297   -2.9718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1442   -3.3843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1442   -4.2093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8587   -2.9718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9449   -2.1513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7519   -1.9798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1644   -2.6942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9714   -2.8658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5234   -2.2527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3304   -2.4242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5853   -3.2088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3923   -3.3803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6472   -4.1650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4542   -4.3365    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.0952   -4.7781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2882   -4.6065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0333   -3.8219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4812   -4.4350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2263   -3.6504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6743   -4.2635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8673   -4.0920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3153   -4.7050    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.6124   -3.3073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9993   -3.8594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5719   -2.1468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2863   -1.7343    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8574   -1.7343    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0  0  0  0
  2  3  1  0  0  0  0
  2  4  1  0  0  0  0
  4  5  1  0  0  0  0
  5  6  1  0  0  0  0
  6  7  1  0  0  0  0
  7  8  1  0  0  0  0
  8  9  2  0  0  0  0
  8 10  1  0  0  0  0
 10 11  1  0  0  0  0
 11 12  1  0  0  0  0
 12 13  1  0  0  0  0
 12 14  1  0  0  0  0
 14 15  1  0  0  0  0
 15 16  1  0  0  0  0
 16 17  1  0  0  0  0
 17 18  1  0  0  0  0
 18 19  1  0  0  0  0
 19 20  1  0  0  0  0
 20 21  1  0  0  0  0
 21 22  1  0  0  0  0
 22 23  1  0  0  0  0
 23 24  1  0  0  0  0
 23 25  1  0  0  0  0
 25 26  1  0  0  0  0
 26 27  1  0  0  0  0
 21 27  1  0  0  0  0
 27 28  1  0  0  0  0
 27 29  1  0  0  0  0
 18 29  1  0  0  0  0
 29 30  1  0  0  0  0
 30 31  1  0  0  0  0
 31 32  1  0  0  0  0
 31 33  1  0  0  0  0
 14 33  1  0  0  0  0
 17 33  1  0  0  0  0
 33 34  1  0  0  0  0
  6 35  1  0  0  0  0
 35 36  2  0  0  0  0
 35 37  1  0  0  0  0
M  END

HMDB0242440
     RDKit          3D
Deoxycholylglutamine
 85 88  0  0  0  0  0  0  0  0999 V2000
    1.5225    2.7718    0.0219 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7595    1.3171   -0.4581 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0475    0.9439    0.2176 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6593   -0.3634   -0.0857 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9115   -0.5273    0.7263 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1864    0.3224    1.5722 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7415   -1.6508    0.5018 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9212   -1.8996    1.2354 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1271   -1.1099    1.0512 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8484   -1.0374   -0.2352 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1746   -0.5066   -1.3959 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9674    0.0944   -2.4416 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9591   -0.5184   -1.5802 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5484   -1.8687    2.7211 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3551   -1.7289    3.0176 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5007   -1.9921    3.7015 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5891    0.4919   -0.0387 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6348   -0.9528   -0.3597 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8640   -1.3530   -0.2579 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4813   -0.2624   -1.0390 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9597   -0.1947   -1.0434 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5165   -1.5053   -1.5066 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9879   -1.6540   -1.2474 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4497   -1.1497    0.0736 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9479   -1.1738    0.1232 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6167   -0.1314   -0.7098 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.9723   -0.0839   -0.3132 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0455    1.2420   -0.6019 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5434    1.2790   -0.5454 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9690    0.2530    0.3877 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4262    0.5712    1.7772 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4710    0.2626    0.2834 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9546    1.6779    0.4405 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4457    1.7165    0.5101 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1008    1.2583    1.7813 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7510    0.9758   -0.5922 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6351    1.8688   -1.7948 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0821    2.7047    1.0315 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.9229    3.3722   -0.6172 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5342    3.2392    0.0779 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.9612    1.2941   -1.5362 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8349    1.7549    0.0310 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9474    1.0135    1.3444 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0563   -1.2497    0.0009 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0694   -0.2697   -1.1575 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4847   -2.3718   -0.2528 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1901   -3.0162    1.1487 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.8989   -1.5253    1.8083 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.0131   -0.0380    1.4365 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.2962   -2.0616   -0.4951 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.8120   -0.4394   -0.0144 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.5966    0.8648   -3.0179 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.9177   -0.2705   -2.5928 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.1942   -2.7407    3.7185 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5682    0.5546    1.0913 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0509   -1.5789    0.4784 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.9690   -1.2189   -1.3512 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1082   -1.3097    0.8246 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9206   -2.3550   -0.6840 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1783   -0.4369   -2.1175 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2411    0.5802   -1.8104 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0201   -2.3966   -1.1267 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3921   -1.5286   -2.6287 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2393   -2.7566   -1.2673 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5662   -1.2268   -2.1021 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0832   -1.8145    0.8815 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2506   -2.1680   -0.3257 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2926   -1.1249    1.1743 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6504   -0.4350   -1.7900 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0509    0.6466    0.3216 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3240    1.7835   -1.5528 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5203    1.7736    0.2292 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1429    1.2248   -1.5739 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2470    2.2784   -0.1592 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5241    0.7428    1.7949 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9647    1.4382    2.2494 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1587   -0.3140    2.4227 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0529   -0.3117    1.1310 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2292    2.1935   -0.5223 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3409    2.2135    1.3100 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1914    2.7930    0.4638 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8735    0.9023    2.2872 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3115    1.8801   -2.3192 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0922    2.8767   -1.6029 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3714    1.4517   -2.5768 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 11 13  2  0
  8 14  1  0
 14 15  2  0
 14 16  1  0
  2 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 26 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 30 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 34 36  1  0
 36 37  1  0
 36 17  1  0
 36 20  1  0
 32 21  1  0
 30 24  1  0
  1 38  1  0
  1 39  1  0
  1 40  1  0
  2 41  1  0
  3 42  1  0
  3 43  1  0
  4 44  1  0
  4 45  1  0
  7 46  1  0
  8 47  1  0
  9 48  1  0
  9 49  1  0
 10 50  1  0
 10 51  1  0
 12 52  1  0
 12 53  1  0
 16 54  1  0
 17 55  1  0
 18 56  1  0
 18 57  1  0
 19 58  1  0
 19 59  1  0
 20 60  1  0
 21 61  1  0
 22 62  1  0
 22 63  1  0
 23 64  1  0
 23 65  1  0
 24 66  1  0
 25 67  1  0
 25 68  1  0
 26 69  1  0
 27 70  1  0
 28 71  1  0
 28 72  1  0
 29 73  1  0
 29 74  1  0
 31 75  1  0
 31 76  1  0
 31 77  1  0
 32 78  1  0
 33 79  1  0
 33 80  1  0
 34 81  1  0
 35 82  1  0
 37 83  1  0
 37 84  1  0
 37 85  1  0
M  END


  Mrv1652308312101052D          

 37 40  0  0  0  0            999 V2000
    9.7140   -2.9718    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.4284   -3.3843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4284   -4.2093    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.1429   -2.9718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8574   -3.3843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5719   -2.9718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2863   -3.3843    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.0008   -2.9718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0008   -2.1468    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7153   -3.3843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4297   -2.9718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1442   -3.3843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1442   -4.2093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8587   -2.9718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9449   -2.1513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7519   -1.9798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1644   -2.6942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9714   -2.8658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5234   -2.2527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3304   -2.4242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5853   -3.2088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3923   -3.3803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6472   -4.1650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4542   -4.3365    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.0952   -4.7781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2882   -4.6065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0333   -3.8219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4812   -4.4350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2263   -3.6504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6743   -4.2635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8673   -4.0920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3153   -4.7050    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.6124   -3.3073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9993   -3.8594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5719   -2.1468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2863   -1.7343    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8574   -1.7343    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0  0  0  0
  2  3  1  0  0  0  0
  2  4  1  0  0  0  0
  4  5  1  0  0  0  0
  5  6  1  0  0  0  0
  6  7  1  0  0  0  0
  7  8  1  0  0  0  0
  8  9  2  0  0  0  0
  8 10  1  0  0  0  0
 10 11  1  0  0  0  0
 11 12  1  0  0  0  0
 12 13  1  0  0  0  0
 12 14  1  0  0  0  0
 14 15  1  0  0  0  0
 15 16  1  0  0  0  0
 16 17  1  0  0  0  0
 17 18  1  0  0  0  0
 18 19  1  0  0  0  0
 19 20  1  0  0  0  0
 20 21  1  0  0  0  0
 21 22  1  0  0  0  0
 22 23  1  0  0  0  0
 23 24  1  0  0  0  0
 23 25  1  0  0  0  0
 25 26  1  0  0  0  0
 26 27  1  0  0  0  0
 21 27  1  0  0  0  0
 27 28  1  0  0  0  0
 27 29  1  0  0  0  0
 18 29  1  0  0  0  0
 29 30  1  0  0  0  0
 30 31  1  0  0  0  0
 31 32  1  0  0  0  0
 31 33  1  0  0  0  0
 14 33  1  0  0  0  0
 17 33  1  0  0  0  0
 33 34  1  0  0  0  0
  6 35  1  0  0  0  0
 35 36  2  0  0  0  0
 35 37  1  0  0  0  0
M  END
> <DATABASE_ID>
MMDBc0057274

> <DATABASE_NAME>
MIME

> <SMILES>
CC(CCC(=O)NC(CCC(N)=O)C(O)=O)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C

> <INCHI_IDENTIFIER>
InChI=1S/C29H48N2O6/c1-16(4-11-26(35)31-23(27(36)37)9-10-25(30)34)20-7-8-21-19-6-5-17-14-18(32)12-13-28(17,2)22(19)15-24(33)29(20,21)3/h16-24,32-33H,4-15H2,1-3H3,(H2,30,34)(H,31,35)(H,36,37)

> <INCHI_KEY>
FLXKZFGVFOVEJM-UHFFFAOYSA-N

> <FORMULA>
C29H48N2O6

> <MOLECULAR_WEIGHT>
520.711

> <EXACT_MASS>
520.351237274

> <JCHEM_ACCEPTOR_COUNT>
6

> <JCHEM_ATOM_COUNT>
85

> <JCHEM_AVERAGE_POLARIZABILITY>
59.364966977703354

> <JCHEM_BIOAVAILABILITY>
1

> <JCHEM_DONOR_COUNT>
5

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
4-carbamoyl-2-(4-{5,16-dihydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-14-yl}pentanamido)butanoic acid

> <ALOGPS_LOGP>
2.18

> <JCHEM_LOGP>
2.094646937666666

> <ALOGPS_LOGS>
-5.28

> <JCHEM_MDDR_LIKE_RULE>
1

> <JCHEM_NUMBER_OF_RINGS>
4

> <JCHEM_PHYSIOLOGICAL_CHARGE>
-1

> <JCHEM_PKA>
14.330611541575259

> <JCHEM_PKA_STRONGEST_ACIDIC>
3.7415098983108503

> <JCHEM_PKA_STRONGEST_BASIC>
-0.26352803799637947

> <JCHEM_POLAR_SURFACE_AREA>
149.95

> <JCHEM_REFRACTIVITY>
139.10680000000002

> <JCHEM_ROTATABLE_BOND_COUNT>
9

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
2.73e-03 g/l

> <JCHEM_TRADITIONAL_IUPAC>
4-carbamoyl-2-(4-{5,16-dihydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-14-yl}pentanamido)butanoic acid

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0242440
     RDKit          3D
Deoxycholylglutamine
 85 88  0  0  0  0  0  0  0  0999 V2000
    1.5225    2.7718    0.0219 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7595    1.3171   -0.4581 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0475    0.9439    0.2176 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6593   -0.3634   -0.0857 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9115   -0.5273    0.7263 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1864    0.3224    1.5722 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7415   -1.6508    0.5018 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9212   -1.8996    1.2354 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1271   -1.1099    1.0512 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8484   -1.0374   -0.2352 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1746   -0.5066   -1.3959 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9674    0.0944   -2.4416 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9591   -0.5184   -1.5802 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5484   -1.8687    2.7211 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3551   -1.7289    3.0176 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5007   -1.9921    3.7015 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5891    0.4919   -0.0387 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6348   -0.9528   -0.3597 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8640   -1.3530   -0.2579 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4813   -0.2624   -1.0390 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9597   -0.1947   -1.0434 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5165   -1.5053   -1.5066 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9879   -1.6540   -1.2474 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4497   -1.1497    0.0736 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9479   -1.1738    0.1232 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6167   -0.1314   -0.7098 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.9723   -0.0839   -0.3132 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0455    1.2420   -0.6019 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5434    1.2790   -0.5454 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9690    0.2530    0.3877 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4262    0.5712    1.7772 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4710    0.2626    0.2834 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9546    1.6779    0.4405 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4457    1.7165    0.5101 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1008    1.2583    1.7813 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7510    0.9758   -0.5922 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6351    1.8688   -1.7948 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0821    2.7047    1.0315 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.9229    3.3722   -0.6172 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5342    3.2392    0.0779 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.9612    1.2941   -1.5362 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8349    1.7549    0.0310 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9474    1.0135    1.3444 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0563   -1.2497    0.0009 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0694   -0.2697   -1.1575 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4847   -2.3718   -0.2528 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1901   -3.0162    1.1487 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.8989   -1.5253    1.8083 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.0131   -0.0380    1.4365 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.2962   -2.0616   -0.4951 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.8120   -0.4394   -0.0144 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.5966    0.8648   -3.0179 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.9177   -0.2705   -2.5928 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.1942   -2.7407    3.7185 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5682    0.5546    1.0913 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0509   -1.5789    0.4784 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.9690   -1.2189   -1.3512 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1082   -1.3097    0.8246 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9206   -2.3550   -0.6840 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1783   -0.4369   -2.1175 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2411    0.5802   -1.8104 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0201   -2.3966   -1.1267 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3921   -1.5286   -2.6287 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2393   -2.7566   -1.2673 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5662   -1.2268   -2.1021 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0832   -1.8145    0.8815 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2506   -2.1680   -0.3257 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2926   -1.1249    1.1743 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6504   -0.4350   -1.7900 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0509    0.6466    0.3216 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3240    1.7835   -1.5528 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5203    1.7736    0.2292 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1429    1.2248   -1.5739 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2470    2.2784   -0.1592 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5241    0.7428    1.7949 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9647    1.4382    2.2494 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1587   -0.3140    2.4227 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0529   -0.3117    1.1310 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2292    2.1935   -0.5223 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3409    2.2135    1.3100 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1914    2.7930    0.4638 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8735    0.9023    2.2872 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3115    1.8801   -2.3192 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0922    2.8767   -1.6029 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3714    1.4517   -2.5768 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 11 13  2  0
  8 14  1  0
 14 15  2  0
 14 16  1  0
  2 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 26 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 30 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 34 36  1  0
 36 37  1  0
 36 17  1  0
 36 20  1  0
 32 21  1  0
 30 24  1  0
  1 38  1  0
  1 39  1  0
  1 40  1  0
  2 41  1  0
  3 42  1  0
  3 43  1  0
  4 44  1  0
  4 45  1  0
  7 46  1  0
  8 47  1  0
  9 48  1  0
  9 49  1  0
 10 50  1  0
 10 51  1  0
 12 52  1  0
 12 53  1  0
 16 54  1  0
 17 55  1  0
 18 56  1  0
 18 57  1  0
 19 58  1  0
 19 59  1  0
 20 60  1  0
 21 61  1  0
 22 62  1  0
 22 63  1  0
 23 64  1  0
 23 65  1  0
 24 66  1  0
 25 67  1  0
 25 68  1  0
 26 69  1  0
 27 70  1  0
 28 71  1  0
 28 72  1  0
 29 73  1  0
 29 74  1  0
 31 75  1  0
 31 76  1  0
 31 77  1  0
 32 78  1  0
 33 79  1  0
 33 80  1  0
 34 81  1  0
 35 82  1  0
 37 83  1  0
 37 84  1  0
 37 85  1  0
M  END

HEADER    PROTEIN                                 31-AUG-21   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   31-AUG-21         0                                  
HETATM    1  O   UNK     0      18.133  -5.547   0.000  0.00  0.00           O+0
HETATM    2  C   UNK     0      19.466  -6.317   0.000  0.00  0.00           C+0
HETATM    3  N   UNK     0      19.466  -7.857   0.000  0.00  0.00           N+0
HETATM    4  C   UNK     0      20.800  -5.547   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0      22.134  -6.317   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0      23.467  -5.547   0.000  0.00  0.00           C+0
HETATM    7  N   UNK     0      24.801  -6.317   0.000  0.00  0.00           N+0
HETATM    8  C   UNK     0      26.135  -5.547   0.000  0.00  0.00           C+0
HETATM    9  O   UNK     0      26.135  -4.007   0.000  0.00  0.00           O+0
HETATM   10  C   UNK     0      27.468  -6.317   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0      28.802  -5.547   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0      30.136  -6.317   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0      30.136  -7.857   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0      31.470  -5.547   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0      31.631  -4.016   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0      33.137  -3.696   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0      33.907  -5.029   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0      35.413  -5.349   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0      36.444  -4.205   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0      37.950  -4.525   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0      38.426  -5.990   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0      39.932  -6.310   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0      40.408  -7.775   0.000  0.00  0.00           C+0
HETATM   24  O   UNK     0      41.914  -8.095   0.000  0.00  0.00           O+0
HETATM   25  C   UNK     0      39.378  -8.919   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0      37.871  -8.599   0.000  0.00  0.00           C+0
HETATM   27  C   UNK     0      37.395  -7.134   0.000  0.00  0.00           C+0
HETATM   28  C   UNK     0      36.365  -8.279   0.000  0.00  0.00           C+0
HETATM   29  C   UNK     0      35.889  -6.814   0.000  0.00  0.00           C+0
HETATM   30  C   UNK     0      34.859  -7.958   0.000  0.00  0.00           C+0
HETATM   31  C   UNK     0      33.352  -7.638   0.000  0.00  0.00           C+0
HETATM   32  O   UNK     0      32.322  -8.783   0.000  0.00  0.00           O+0
HETATM   33  C   UNK     0      32.876  -6.174   0.000  0.00  0.00           C+0
HETATM   34  C   UNK     0      31.732  -7.204   0.000  0.00  0.00           C+0
HETATM   35  C   UNK     0      23.467  -4.007   0.000  0.00  0.00           C+0
HETATM   36  O   UNK     0      24.801  -3.237   0.000  0.00  0.00           O+0
HETATM   37  O   UNK     0      22.134  -3.237   0.000  0.00  0.00           O+0
CONECT    1    2                                                            
CONECT    2    1    3    4                                                  
CONECT    3    2                                                            
CONECT    4    2    5                                                       
CONECT    5    4    6                                                       
CONECT    6    5    7   35                                                  
CONECT    7    6    8                                                       
CONECT    8    7    9   10                                                  
CONECT    9    8                                                            
CONECT   10    8   11                                                       
CONECT   11   10   12                                                       
CONECT   12   11   13   14                                                  
CONECT   13   12                                                            
CONECT   14   12   15   33                                                  
CONECT   15   14   16                                                       
CONECT   16   15   17                                                       
CONECT   17   16   18   33                                                  
CONECT   18   17   19   29                                                  
CONECT   19   18   20                                                       
CONECT   20   19   21                                                       
CONECT   21   20   22   27                                                  
CONECT   22   21   23                                                       
CONECT   23   22   24   25                                                  
CONECT   24   23                                                            
CONECT   25   23   26                                                       
CONECT   26   25   27                                                       
CONECT   27   26   21   28   29                                             
CONECT   28   27                                                            
CONECT   29   27   18   30                                                  
CONECT   30   29   31                                                       
CONECT   31   30   32   33                                                  
CONECT   32   31                                                            
CONECT   33   31   14   17   34                                             
CONECT   34   33                                                            
CONECT   35    6   36   37                                                  
CONECT   36   35                                                            
CONECT   37   35                                                            
MASTER        0    0    0    0    0    0    0    0   37    0   80    0
END

COMPND    HMDB0242440
HETATM    1  C1  UNL     1       1.523   2.772   0.022  1.00  0.00           C  
HETATM    2  C2  UNL     1       1.759   1.317  -0.458  1.00  0.00           C  
HETATM    3  C3  UNL     1       3.047   0.944   0.218  1.00  0.00           C  
HETATM    4  C4  UNL     1       3.659  -0.363  -0.086  1.00  0.00           C  
HETATM    5  C5  UNL     1       4.912  -0.527   0.726  1.00  0.00           C  
HETATM    6  O1  UNL     1       5.186   0.322   1.572  1.00  0.00           O  
HETATM    7  N1  UNL     1       5.742  -1.651   0.502  1.00  0.00           N  
HETATM    8  C6  UNL     1       6.921  -1.900   1.235  1.00  0.00           C  
HETATM    9  C7  UNL     1       8.127  -1.110   1.051  1.00  0.00           C  
HETATM   10  C8  UNL     1       8.848  -1.037  -0.235  1.00  0.00           C  
HETATM   11  C9  UNL     1       8.175  -0.507  -1.396  1.00  0.00           C  
HETATM   12  N2  UNL     1       8.967   0.094  -2.442  1.00  0.00           N  
HETATM   13  O2  UNL     1       6.959  -0.518  -1.580  1.00  0.00           O  
HETATM   14  C10 UNL     1       6.548  -1.869   2.721  1.00  0.00           C  
HETATM   15  O3  UNL     1       5.355  -1.729   3.018  1.00  0.00           O  
HETATM   16  O4  UNL     1       7.501  -1.992   3.701  1.00  0.00           O  
HETATM   17  C11 UNL     1       0.589   0.492  -0.039  1.00  0.00           C  
HETATM   18  C12 UNL     1       0.635  -0.953  -0.360  1.00  0.00           C  
HETATM   19  C13 UNL     1      -0.864  -1.353  -0.258  1.00  0.00           C  
HETATM   20  C14 UNL     1      -1.481  -0.262  -1.039  1.00  0.00           C  
HETATM   21  C15 UNL     1      -2.960  -0.195  -1.043  1.00  0.00           C  
HETATM   22  C16 UNL     1      -3.517  -1.505  -1.507  1.00  0.00           C  
HETATM   23  C17 UNL     1      -4.988  -1.654  -1.247  1.00  0.00           C  
HETATM   24  C18 UNL     1      -5.450  -1.150   0.074  1.00  0.00           C  
HETATM   25  C19 UNL     1      -6.948  -1.174   0.123  1.00  0.00           C  
HETATM   26  C20 UNL     1      -7.617  -0.131  -0.710  1.00  0.00           C  
HETATM   27  O5  UNL     1      -8.972  -0.084  -0.313  1.00  0.00           O  
HETATM   28  C21 UNL     1      -7.045   1.242  -0.602  1.00  0.00           C  
HETATM   29  C22 UNL     1      -5.543   1.279  -0.545  1.00  0.00           C  
HETATM   30  C23 UNL     1      -4.969   0.253   0.388  1.00  0.00           C  
HETATM   31  C24 UNL     1      -5.426   0.571   1.777  1.00  0.00           C  
HETATM   32  C25 UNL     1      -3.471   0.263   0.283  1.00  0.00           C  
HETATM   33  C26 UNL     1      -2.955   1.678   0.441  1.00  0.00           C  
HETATM   34  C27 UNL     1      -1.446   1.716   0.510  1.00  0.00           C  
HETATM   35  O6  UNL     1      -1.101   1.258   1.781  1.00  0.00           O  
HETATM   36  C28 UNL     1      -0.751   0.976  -0.592  1.00  0.00           C  
HETATM   37  C29 UNL     1      -0.635   1.869  -1.795  1.00  0.00           C  
HETATM   38  H1  UNL     1       1.082   2.705   1.031  1.00  0.00           H  
HETATM   39  H2  UNL     1       0.923   3.372  -0.617  1.00  0.00           H  
HETATM   40  H3  UNL     1       2.534   3.239   0.078  1.00  0.00           H  
HETATM   41  H4  UNL     1       1.961   1.294  -1.536  1.00  0.00           H  
HETATM   42  H5  UNL     1       3.835   1.755   0.031  1.00  0.00           H  
HETATM   43  H6  UNL     1       2.947   1.013   1.344  1.00  0.00           H  
HETATM   44  H7  UNL     1       3.056  -1.250   0.001  1.00  0.00           H  
HETATM   45  H8  UNL     1       4.069  -0.270  -1.157  1.00  0.00           H  
HETATM   46  H9  UNL     1       5.485  -2.372  -0.253  1.00  0.00           H  
HETATM   47  H10 UNL     1       7.190  -3.016   1.149  1.00  0.00           H  
HETATM   48  H11 UNL     1       8.899  -1.525   1.808  1.00  0.00           H  
HETATM   49  H12 UNL     1       8.013  -0.038   1.437  1.00  0.00           H  
HETATM   50  H13 UNL     1       9.296  -2.062  -0.495  1.00  0.00           H  
HETATM   51  H14 UNL     1       9.812  -0.439  -0.014  1.00  0.00           H  
HETATM   52  H15 UNL     1       8.597   0.865  -3.018  1.00  0.00           H  
HETATM   53  H16 UNL     1       9.918  -0.271  -2.593  1.00  0.00           H  
HETATM   54  H17 UNL     1       8.194  -2.741   3.718  1.00  0.00           H  
HETATM   55  H18 UNL     1       0.568   0.555   1.091  1.00  0.00           H  
HETATM   56  H19 UNL     1       1.051  -1.579   0.478  1.00  0.00           H  
HETATM   57  H20 UNL     1       0.969  -1.219  -1.351  1.00  0.00           H  
HETATM   58  H21 UNL     1      -1.108  -1.310   0.825  1.00  0.00           H  
HETATM   59  H22 UNL     1      -0.921  -2.355  -0.684  1.00  0.00           H  
HETATM   60  H23 UNL     1      -1.178  -0.437  -2.118  1.00  0.00           H  
HETATM   61  H24 UNL     1      -3.241   0.580  -1.810  1.00  0.00           H  
HETATM   62  H25 UNL     1      -3.020  -2.397  -1.127  1.00  0.00           H  
HETATM   63  H26 UNL     1      -3.392  -1.529  -2.629  1.00  0.00           H  
HETATM   64  H27 UNL     1      -5.239  -2.757  -1.267  1.00  0.00           H  
HETATM   65  H28 UNL     1      -5.566  -1.227  -2.102  1.00  0.00           H  
HETATM   66  H29 UNL     1      -5.083  -1.815   0.881  1.00  0.00           H  
HETATM   67  H30 UNL     1      -7.251  -2.168  -0.326  1.00  0.00           H  
HETATM   68  H31 UNL     1      -7.293  -1.125   1.174  1.00  0.00           H  
HETATM   69  H32 UNL     1      -7.650  -0.435  -1.790  1.00  0.00           H  
HETATM   70  H33 UNL     1      -9.051   0.647   0.322  1.00  0.00           H  
HETATM   71  H34 UNL     1      -7.324   1.783  -1.553  1.00  0.00           H  
HETATM   72  H35 UNL     1      -7.520   1.774   0.229  1.00  0.00           H  
HETATM   73  H36 UNL     1      -5.143   1.225  -1.574  1.00  0.00           H  
HETATM   74  H37 UNL     1      -5.247   2.278  -0.159  1.00  0.00           H  
HETATM   75  H38 UNL     1      -6.524   0.743   1.795  1.00  0.00           H  
HETATM   76  H39 UNL     1      -4.965   1.438   2.249  1.00  0.00           H  
HETATM   77  H40 UNL     1      -5.159  -0.314   2.423  1.00  0.00           H  
HETATM   78  H41 UNL     1      -3.053  -0.312   1.131  1.00  0.00           H  
HETATM   79  H42 UNL     1      -3.229   2.193  -0.522  1.00  0.00           H  
HETATM   80  H43 UNL     1      -3.341   2.213   1.310  1.00  0.00           H  
HETATM   81  H44 UNL     1      -1.191   2.793   0.464  1.00  0.00           H  
HETATM   82  H45 UNL     1      -1.874   0.902   2.287  1.00  0.00           H  
HETATM   83  H46 UNL     1       0.312   1.880  -2.319  1.00  0.00           H  
HETATM   84  H47 UNL     1      -1.092   2.877  -1.603  1.00  0.00           H  
HETATM   85  H48 UNL     1      -1.371   1.452  -2.577  1.00  0.00           H  
CONECT    1    2   38   39   40
CONECT    2    3   17   41
CONECT    3    4   42   43
CONECT    4    5   44   45
CONECT    5    6    6    7
CONECT    7    8   46
CONECT    8    9   14   47
CONECT    9   10   48   49
CONECT   10   11   50   51
CONECT   11   12   13   13
CONECT   12   52   53
CONECT   14   15   15   16
CONECT   16   54
CONECT   17   18   36   55
CONECT   18   19   56   57
CONECT   19   20   58   59
CONECT   20   21   36   60
CONECT   21   22   32   61
CONECT   22   23   62   63
CONECT   23   24   64   65
CONECT   24   25   30   66
CONECT   25   26   67   68
CONECT   26   27   28   69
CONECT   27   70
CONECT   28   29   71   72
CONECT   29   30   73   74
CONECT   30   31   32
CONECT   31   75   76   77
CONECT   32   33   78
CONECT   33   34   79   80
CONECT   34   35   36   81
CONECT   35   82
CONECT   36   37
CONECT   37   83   84   85
END

HMDB0242440
     RDKit          3D
Deoxycholylglutamine
 85 88  0  0  0  0  0  0  0  0999 V2000
    1.5225    2.7718    0.0219 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7595    1.3171   -0.4581 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0475    0.9439    0.2176 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6593   -0.3634   -0.0857 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9115   -0.5273    0.7263 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1864    0.3224    1.5722 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7415   -1.6508    0.5018 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9212   -1.8996    1.2354 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1271   -1.1099    1.0512 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8484   -1.0374   -0.2352 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1746   -0.5066   -1.3959 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9674    0.0944   -2.4416 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9591   -0.5184   -1.5802 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5484   -1.8687    2.7211 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3551   -1.7289    3.0176 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5007   -1.9921    3.7015 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5891    0.4919   -0.0387 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6348   -0.9528   -0.3597 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8640   -1.3530   -0.2579 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4813   -0.2624   -1.0390 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9597   -0.1947   -1.0434 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5165   -1.5053   -1.5066 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9879   -1.6540   -1.2474 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4497   -1.1497    0.0736 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9479   -1.1738    0.1232 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6167   -0.1314   -0.7098 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.9723   -0.0839   -0.3132 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0455    1.2420   -0.6019 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5434    1.2790   -0.5454 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9690    0.2530    0.3877 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4262    0.5712    1.7772 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4710    0.2626    0.2834 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9546    1.6779    0.4405 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4457    1.7165    0.5101 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1008    1.2583    1.7813 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7510    0.9758   -0.5922 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6351    1.8688   -1.7948 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0821    2.7047    1.0315 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.9229    3.3722   -0.6172 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5342    3.2392    0.0779 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.9612    1.2941   -1.5362 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8349    1.7549    0.0310 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9474    1.0135    1.3444 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0563   -1.2497    0.0009 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0694   -0.2697   -1.1575 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4847   -2.3718   -0.2528 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1901   -3.0162    1.1487 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.8989   -1.5253    1.8083 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.0131   -0.0380    1.4365 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.2962   -2.0616   -0.4951 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.8120   -0.4394   -0.0144 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.5966    0.8648   -3.0179 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.9177   -0.2705   -2.5928 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.1942   -2.7407    3.7185 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5682    0.5546    1.0913 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0509   -1.5789    0.4784 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.9690   -1.2189   -1.3512 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1082   -1.3097    0.8246 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9206   -2.3550   -0.6840 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1783   -0.4369   -2.1175 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2411    0.5802   -1.8104 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0201   -2.3966   -1.1267 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3921   -1.5286   -2.6287 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2393   -2.7566   -1.2673 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5662   -1.2268   -2.1021 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0832   -1.8145    0.8815 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2506   -2.1680   -0.3257 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2926   -1.1249    1.1743 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6504   -0.4350   -1.7900 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0509    0.6466    0.3216 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3240    1.7835   -1.5528 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5203    1.7736    0.2292 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1429    1.2248   -1.5739 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2470    2.2784   -0.1592 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5241    0.7428    1.7949 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9647    1.4382    2.2494 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1587   -0.3140    2.4227 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0529   -0.3117    1.1310 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2292    2.1935   -0.5223 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3409    2.2135    1.3100 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1914    2.7930    0.4638 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8735    0.9023    2.2872 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3115    1.8801   -2.3192 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0922    2.8767   -1.6029 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3714    1.4517   -2.5768 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 11 13  2  0
  8 14  1  0
 14 15  2  0
 14 16  1  0
  2 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 26 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 30 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 34 36  1  0
 36 37  1  0
 36 17  1  0
 36 20  1  0
 32 21  1  0
 30 24  1  0
  1 38  1  0
  1 39  1  0
  1 40  1  0
  2 41  1  0
  3 42  1  0
  3 43  1  0
  4 44  1  0
  4 45  1  0
  7 46  1  0
  8 47  1  0
  9 48  1  0
  9 49  1  0
 10 50  1  0
 10 51  1  0
 12 52  1  0
 12 53  1  0
 16 54  1  0
 17 55  1  0
 18 56  1  0
 18 57  1  0
 19 58  1  0
 19 59  1  0
 20 60  1  0
 21 61  1  0
 22 62  1  0
 22 63  1  0
 23 64  1  0
 23 65  1  0
 24 66  1  0
 25 67  1  0
 25 68  1  0
 26 69  1  0
 27 70  1  0
 28 71  1  0
 28 72  1  0
 29 73  1  0
 29 74  1  0
 31 75  1  0
 31 76  1  0
 31 77  1  0
 32 78  1  0
 33 79  1  0
 33 80  1  0
 34 81  1  0
 35 82  1  0
 37 83  1  0
 37 84  1  0
 37 85  1  0
M  END

Synonyms

Value	Source
Deoxycholylglutamine	HMDB
Gln-Deoxycho	HMDB
Gln-DCA	HMDB
Glutaminodeoxycholic acid	HMDB
Glutaminodeoxycholate	HMDB

Molecular Formula

C₂₉H₄₈N₂O₆

Average Mass

520.711

Monoisotopic Mass

520.351237274

IUPAC Name

4-carbamoyl-2-(4-{5,16-dihydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-14-yl}pentanamido)butanoic acid

Traditional Name

4-carbamoyl-2-(4-{5,16-dihydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-14-yl}pentanamido)butanoic acid

CAS Registry Number

Not Available

SMILES

CC(CCC(=O)NC(CCC(N)=O)C(O)=O)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C

InChI Identifier

InChI=1S/C29H48N2O6/c1-16(4-11-26(35)31-23(27(36)37)9-10-25(30)34)20-7-8-21-19-6-5-17-14-18(32)12-13-28(17,2)22(19)15-24(33)29(20,21)3/h16-24,32-33H,4-15H2,1-3H3,(H2,30,34)(H,31,35)(H,36,37)

InChI Key

FLXKZFGVFOVEJM-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as glycinated bile acids and derivatives. Glycinated bile acids and derivatives are compounds with a structure characterized by the presence of a glycine linked to a bile acid skeleton.

Kingdom

Organic compounds

Super Class

Lipids and lipid-like molecules

Class

Steroids and steroid derivatives

Sub Class

Bile acids, alcohols and derivatives

Direct Parent

Glycinated bile acids and derivatives

Alternative Parents

Substituents

Glycinated bile acid
Dihydroxy bile acid, alcohol, or derivatives
Hydroxy bile acid, alcohol, or derivatives
Hydroxysteroid
12-hydroxysteroid
3-hydroxysteroid
Glutamine or derivatives
N-acyl-alpha amino acid or derivatives
N-acyl-alpha-amino acid
Alpha-amino acid or derivatives
Fatty acyl
N-acyl-amine
Fatty amide
Cyclic alcohol
Secondary carboxylic acid amide
Secondary alcohol
Primary carboxylic acid amide
Carboxamide group
Monocarboxylic acid or derivatives
Carboxylic acid
Carboxylic acid derivative
Organic nitrogen compound
Organic oxygen compound
Organopnictogen compound
Organic oxide
Hydrocarbon derivative
Organooxygen compound
Organonitrogen compound
Carbonyl group
Alcohol
Aliphatic homopolycyclic compound

Molecular Framework

Aliphatic homopolycyclic compounds

External Descriptors

Not Available

Functional Ontology

Not Available

Physical Properties

State

Not Available

Predicted Properties

Property	Value	Source
Water Solubility	0.0027 g/L	ALOGPS
logP	2.18	ALOGPS
logP	2.09	ChemAxon
logS	-5.3	ALOGPS
pKa (Strongest Acidic)	3.74	ChemAxon
pKa (Strongest Basic)	-0.26	ChemAxon
Physiological Charge	-1	ChemAxon
Hydrogen Acceptor Count	6	ChemAxon
Hydrogen Donor Count	5	ChemAxon
Polar Surface Area	149.95 Å²	ChemAxon
Rotatable Bond Count	9	ChemAxon
Refractivity	139.11 m³·mol⁻¹	ChemAxon
Polarizability	59.36 Å³	ChemAxon
Number of Rings	4	ChemAxon
Bioavailability	Yes	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	Yes	ChemAxon

Spectra

Spectrum Type	Description	Splash Key	Deposition Date	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 10V, Positive	splash10-00di-0001190000-a2dbc1f6d333b601c1f4	2021-10-12	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 20V, Positive	splash10-0kar-2905530000-502ecdbfd5015d223b58	2021-10-12	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 40V, Positive	splash10-0f8a-9812000000-fef1668c349d8a8b038b	2021-10-12	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 10V, Negative	splash10-014i-0000090000-43608b5dfafd5e5f5c77	2021-10-12	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 20V, Negative	splash10-0006-9000120000-ecfe138914aeeaca3727	2021-10-12	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 40V, Negative	splash10-0006-9302300000-70282e9b472a9895d6f7	2021-10-12	View Spectrum

Chromatographic Retention Times and Retention Indices

Retention Times

Chromatography Type	Technique	Column	Deposition Date	Retention Time (s)
Liquid Chromatography	HILIC	Waters Acquity UPLC-BEH Amide column (eluted)	2025-10-24	408.7
Liquid Chromatography	HILIC	Accucore 150 Amide HILIC (eluted)	2025-10-24	198.8
Liquid Chromatography	Reversed-phase	Hypersil Gold 1.9 µm C18 (eluted)	2025-10-24	532.3
Liquid Chromatography	Reversed-phase	Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) (eluted)	2025-10-24	558.6
Liquid Chromatography	Reversed-phase	XBridge C18 3.5u 2.1x50 mm (eluted)	2025-10-24	494.2
Liquid Chromatography	Reversed-phase	Ascentis Express C18 (eluted)	2025-10-24	159.1
Liquid Chromatography	Reversed-phase	Waters ACQUITY UPLC HSS T3 C18 (eluted)	2025-10-24	2749.4
Liquid Chromatography	HILIC	Merck SeQuant ZIC-HILIC (eluted)	2025-10-24	417.6
Liquid Chromatography	HILIC	Merck SeQuant ZIC-pHILIC (eluted)	2025-10-24	308.8
Liquid Chromatography	Reversed-phase	Waters ACQUITY UPLC HSS T3 C18 (eluted)	2025-10-24	477.8
Liquid Chromatography	HILIC	Merck SeQuant ZIC-HILIC (eluted)	2025-10-24	313.4
Liquid Chromatography	Reversed-phase	Waters ACQUITY UPLC HSS T3 C18 (eluted)	2025-10-24	166.5
Liquid Chromatography	Reversed-phase	Waters ACQUITY UPLC BEH C18 (eluted)	2025-10-24	211.1
Liquid Chromatography	HILIC	Merck SeQuant ZIC-pHILIC column (eluted)	2025-10-24	146.7
Liquid Chromatography	HILIC	Merck SeQuant ZIC-pHILIC column (eluted)	2025-10-24	292.2
Liquid Chromatography	Reversed-phase	Waters ACQUITY UPLC BEH C18 (eluted)	2025-10-24	432.5
Liquid Chromatography	Reversed-phase	Waters ACQUITY UPLC BEH C18 (eluted)	2025-10-24	410.1
Liquid Chromatography	Reversed-phase	Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex (eluted)	2025-10-24	1538.6
Liquid Chromatography	Reversed-phase	Waters Atlantis T3 (2.1 x 150 mm, 5 um) (eluted)	2025-10-24	1034.7

Retention Indices

Chromatography Type	Peak Label	SMILES	Stationary Phase	Deposition Date	Retention Index
Gas Chromatography	Deoxycholylglutamine_TMS_1	CC(CCC(=O)NC(CCC(N)=O)C(=O)O[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C	standard non polar	2025-10-24	1747.67
Gas Chromatography	Deoxycholylglutamine_TMS_2	CC(CCC(=O)NC(CCC(N)=O)C(=O)O)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O)C12C	standard non polar	2025-10-24	2288.02
Gas Chromatography	Deoxycholylglutamine_TMS_3	CC(CCC(=O)NC(CCC(N)=O)C(=O)O)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard non polar	2025-10-24	2120.2
Gas Chromatography	Deoxycholylglutamine_TMS_4	CC(CCC(=O)NC(CCC(=O)N[Si](C)(C)C)C(=O)O)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C	standard non polar	2025-10-24	1916.43
Gas Chromatography	Deoxycholylglutamine_TMS_5	CC(CCC(=O)N(C(CCC(N)=O)C(=O)O)[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C	standard non polar	2025-10-24	991.419
Gas Chromatography	Deoxycholylglutamine_TMS_6	CC(CCC(=O)NC(CCC(N)=O)C(=O)O[Si](C)(C)C)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O)C12C	standard non polar	2025-10-24	2392.9
Gas Chromatography	Deoxycholylglutamine_TMS_7	CC(CCC(=O)NC(CCC(N)=O)C(=O)O[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard non polar	2025-10-24	814.838
Gas Chromatography	Deoxycholylglutamine_TMS_8	CC(CCC(=O)NC(CCC(=O)N[Si](C)(C)C)C(=O)O[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C	standard non polar	2025-10-24	878.973
Gas Chromatography	Deoxycholylglutamine_TMS_9	CC(CCC(=O)N(C(CCC(N)=O)C(=O)O[Si](C)(C)C)[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C	standard non polar	2025-10-24	2136.49
Gas Chromatography	Deoxycholylglutamine_TMS_10	CC(CCC(=O)NC(CCC(N)=O)C(=O)O)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard non polar	2025-10-24	1968.97
Gas Chromatography	Deoxycholylglutamine_TMS_11	CC(CCC(=O)NC(CCC(=O)N[Si](C)(C)C)C(=O)O)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O)C12C	standard non polar	2025-10-24	1384.11
Gas Chromatography	Deoxycholylglutamine_TMS_12	CC(CCC(=O)N(C(CCC(N)=O)C(=O)O)[Si](C)(C)C)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O)C12C	standard non polar	2025-10-24	1831.09
Gas Chromatography	Deoxycholylglutamine_TMS_13	CC(CCC(=O)NC(CCC(=O)N[Si](C)(C)C)C(=O)O)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard non polar	2025-10-24	2700.74
Gas Chromatography	Deoxycholylglutamine_TMS_14	CC(CCC(=O)N(C(CCC(N)=O)C(=O)O)[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard non polar	2025-10-24	1127.52
Gas Chromatography	Deoxycholylglutamine_TMS_15	CC(CCC(=O)N(C(CCC(=O)N[Si](C)(C)C)C(=O)O)[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C	standard non polar	2025-10-24	1866.73
Gas Chromatography	Deoxycholylglutamine_TMS_16	CC(CCC(=O)NC(CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C	standard non polar	2025-10-24	1974.8
Gas Chromatography	Deoxycholylglutamine_TMS_17	CC(CCC(=O)NC(CCC(N)=O)C(=O)O[Si](C)(C)C)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard non polar	2025-10-24	745.806
Gas Chromatography	Deoxycholylglutamine_TMS_18	CC(CCC(=O)NC(CCC(=O)N[Si](C)(C)C)C(=O)O[Si](C)(C)C)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O)C12C	standard non polar	2025-10-24	1469.53
Gas Chromatography	Deoxycholylglutamine_TMS_19	CC(CCC(=O)N(C(CCC(N)=O)C(=O)O[Si](C)(C)C)[Si](C)(C)C)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O)C12C	standard non polar	2025-10-24	1327.71
Gas Chromatography	Deoxycholylglutamine_TMS_20	CC(CCC(=O)NC(CCC(=O)N[Si](C)(C)C)C(=O)O[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard non polar	2025-10-24	1706.68
Gas Chromatography	Deoxycholylglutamine_TMS_21	CC(CCC(=O)N(C(CCC(N)=O)C(=O)O[Si](C)(C)C)[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard non polar	2025-10-24	2680.78
Gas Chromatography	Deoxycholylglutamine_TMS_22	CC(CCC(=O)N(C(CCC(=O)N[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C	standard non polar	2025-10-24	1222.66
Gas Chromatography	Deoxycholylglutamine_TMS_23	CC(CCC(=O)NC(CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C	standard non polar	2025-10-24	2783.57
Gas Chromatography	Deoxycholylglutamine_TMS_24	CC(CCC(=O)NC(CCC(=O)N[Si](C)(C)C)C(=O)O)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard non polar	2025-10-24	1887.35
Gas Chromatography	Deoxycholylglutamine_TMS_25	CC(CCC(=O)N(C(CCC(N)=O)C(=O)O)[Si](C)(C)C)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard non polar	2025-10-24	1993.33
Gas Chromatography	Deoxycholylglutamine_TMS_26	CC(CCC(=O)N(C(CCC(=O)N[Si](C)(C)C)C(=O)O)[Si](C)(C)C)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O)C12C	standard non polar	2025-10-24	2014.13
Gas Chromatography	Deoxycholylglutamine_TMS_27	CC(CCC(=O)NC(CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O)C12C	standard non polar	2025-10-24	1159.34
Gas Chromatography	Deoxycholylglutamine_TMS_28	CC(CCC(=O)N(C(CCC(=O)N[Si](C)(C)C)C(=O)O)[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard non polar	2025-10-24	1349.98
Gas Chromatography	Deoxycholylglutamine_TMS_29	CC(CCC(=O)NC(CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard non polar	2025-10-24	2392.73
Gas Chromatography	Deoxycholylglutamine_TMS_30	CC(CCC(=O)N(C(CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O)[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C	standard non polar	2025-10-24	988.99
Gas Chromatography	Deoxycholylglutamine_TMS_31	CC(CCC(=O)NC(CCC(=O)N[Si](C)(C)C)C(=O)O[Si](C)(C)C)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard non polar	2025-10-24	1700.5
Gas Chromatography	Deoxycholylglutamine_TMS_32	CC(CCC(=O)N(C(CCC(N)=O)C(=O)O[Si](C)(C)C)[Si](C)(C)C)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard non polar	2025-10-24	2409.67
Gas Chromatography	Deoxycholylglutamine_TMS_33	CC(CCC(=O)N(C(CCC(=O)N[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O)C12C	standard non polar	2025-10-24	1733.72
Gas Chromatography	Deoxycholylglutamine_TMS_34	CC(CCC(=O)NC(CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O)C12C	standard non polar	2025-10-24	1536.13
Gas Chromatography	Deoxycholylglutamine_TMS_35	CC(CCC(=O)N(C(CCC(=O)N[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard non polar	2025-10-24	2767.42
Gas Chromatography	Deoxycholylglutamine_TMS_36	CC(CCC(=O)NC(CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard non polar	2025-10-24	3158.64
Gas Chromatography	Deoxycholylglutamine_TMS_37	CC(CCC(=O)N(C(CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C	standard non polar	2025-10-24	2933.17
Gas Chromatography	Deoxycholylglutamine_TMS_38	CC(CCC(=O)N(C(CCC(=O)N[Si](C)(C)C)C(=O)O)[Si](C)(C)C)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard non polar	2025-10-24	2806.88
Gas Chromatography	Deoxycholylglutamine_TMS_39	CC(CCC(=O)NC(CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard non polar	2025-10-24	2437.45
Gas Chromatography	Deoxycholylglutamine_TMS_40	CC(CCC(=O)N(C(CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O)[Si](C)(C)C)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O)C12C	standard non polar	2025-10-24	2600.38
Gas Chromatography	Deoxycholylglutamine_TMS_41	CC(CCC(=O)N(C(CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O)[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard non polar	2025-10-24	1703.07
Gas Chromatography	Deoxycholylglutamine_TMS_42	CC(CCC(=O)N(C(CCC(=O)N[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard non polar	2025-10-24	1467.57
Gas Chromatography	Deoxycholylglutamine_TMS_43	CC(CCC(=O)NC(CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard non polar	2025-10-24	1538.34
Gas Chromatography	Deoxycholylglutamine_TMS_44	CC(CCC(=O)N(C(CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O)C12C	standard non polar	2025-10-24	1752.72
Gas Chromatography	Deoxycholylglutamine_TMS_45	CC(CCC(=O)N(C(CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard non polar	2025-10-24	1300.43
Gas Chromatography	Deoxycholylglutamine_TMS_46	CC(CCC(=O)N(C(CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O)[Si](C)(C)C)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard non polar	2025-10-24	708.847
Gas Chromatography	Deoxycholylglutamine_TMS_1	CC(CCC(=O)NC(CCC(N)=O)C(=O)O[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C	standard polar	2025-10-24	2449.66
Gas Chromatography	Deoxycholylglutamine_TMS_2	CC(CCC(=O)NC(CCC(N)=O)C(=O)O)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O)C12C	standard polar	2025-10-24	1405.79
Gas Chromatography	Deoxycholylglutamine_TMS_3	CC(CCC(=O)NC(CCC(N)=O)C(=O)O)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard polar	2025-10-24	2296.08
Gas Chromatography	Deoxycholylglutamine_TMS_4	CC(CCC(=O)NC(CCC(=O)N[Si](C)(C)C)C(=O)O)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C	standard polar	2025-10-24	1844.62
Gas Chromatography	Deoxycholylglutamine_TMS_5	CC(CCC(=O)N(C(CCC(N)=O)C(=O)O)[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C	standard polar	2025-10-24	2578.82
Gas Chromatography	Deoxycholylglutamine_TMS_6	CC(CCC(=O)NC(CCC(N)=O)C(=O)O[Si](C)(C)C)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O)C12C	standard polar	2025-10-24	1488.93
Gas Chromatography	Deoxycholylglutamine_TMS_7	CC(CCC(=O)NC(CCC(N)=O)C(=O)O[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard polar	2025-10-24	1732.59
Gas Chromatography	Deoxycholylglutamine_TMS_8	CC(CCC(=O)NC(CCC(=O)N[Si](C)(C)C)C(=O)O[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C	standard polar	2025-10-24	2465.11
Gas Chromatography	Deoxycholylglutamine_TMS_9	CC(CCC(=O)N(C(CCC(N)=O)C(=O)O[Si](C)(C)C)[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C	standard polar	2025-10-24	1940.12
Gas Chromatography	Deoxycholylglutamine_TMS_10	CC(CCC(=O)NC(CCC(N)=O)C(=O)O)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard polar	2025-10-24	81.9945
Gas Chromatography	Deoxycholylglutamine_TMS_11	CC(CCC(=O)NC(CCC(=O)N[Si](C)(C)C)C(=O)O)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O)C12C	standard polar	2025-10-24	3235.09
Gas Chromatography	Deoxycholylglutamine_TMS_12	CC(CCC(=O)N(C(CCC(N)=O)C(=O)O)[Si](C)(C)C)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O)C12C	standard polar	2025-10-24	2706.4
Gas Chromatography	Deoxycholylglutamine_TMS_13	CC(CCC(=O)NC(CCC(=O)N[Si](C)(C)C)C(=O)O)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard polar	2025-10-24	3022.03
Gas Chromatography	Deoxycholylglutamine_TMS_14	CC(CCC(=O)N(C(CCC(N)=O)C(=O)O)[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard polar	2025-10-24	1733.1
Gas Chromatography	Deoxycholylglutamine_TMS_15	CC(CCC(=O)N(C(CCC(=O)N[Si](C)(C)C)C(=O)O)[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C	standard polar	2025-10-24	1002.99
Gas Chromatography	Deoxycholylglutamine_TMS_16	CC(CCC(=O)NC(CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C	standard polar	2025-10-24	2557.07
Gas Chromatography	Deoxycholylglutamine_TMS_17	CC(CCC(=O)NC(CCC(N)=O)C(=O)O[Si](C)(C)C)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard polar	2025-10-24	2125.47
Gas Chromatography	Deoxycholylglutamine_TMS_18	CC(CCC(=O)NC(CCC(=O)N[Si](C)(C)C)C(=O)O[Si](C)(C)C)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O)C12C	standard polar	2025-10-24	1601.66
Gas Chromatography	Deoxycholylglutamine_TMS_19	CC(CCC(=O)N(C(CCC(N)=O)C(=O)O[Si](C)(C)C)[Si](C)(C)C)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O)C12C	standard polar	2025-10-24	2556.92
Gas Chromatography	Deoxycholylglutamine_TMS_20	CC(CCC(=O)NC(CCC(=O)N[Si](C)(C)C)C(=O)O[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard polar	2025-10-24	2186.09
Gas Chromatography	Deoxycholylglutamine_TMS_21	CC(CCC(=O)N(C(CCC(N)=O)C(=O)O[Si](C)(C)C)[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard polar	2025-10-24	525.574
Gas Chromatography	Deoxycholylglutamine_TMS_22	CC(CCC(=O)N(C(CCC(=O)N[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C	standard polar	2025-10-24	1935.19
Gas Chromatography	Deoxycholylglutamine_TMS_23	CC(CCC(=O)NC(CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C	standard polar	2025-10-24	2556.61
Gas Chromatography	Deoxycholylglutamine_TMS_24	CC(CCC(=O)NC(CCC(=O)N[Si](C)(C)C)C(=O)O)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard polar	2025-10-24	2918.17
Gas Chromatography	Deoxycholylglutamine_TMS_25	CC(CCC(=O)N(C(CCC(N)=O)C(=O)O)[Si](C)(C)C)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard polar	2025-10-24	2022.4
Gas Chromatography	Deoxycholylglutamine_TMS_26	CC(CCC(=O)N(C(CCC(=O)N[Si](C)(C)C)C(=O)O)[Si](C)(C)C)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O)C12C	standard polar	2025-10-24	1837.89
Gas Chromatography	Deoxycholylglutamine_TMS_27	CC(CCC(=O)NC(CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O)C12C	standard polar	2025-10-24	1849.53
Gas Chromatography	Deoxycholylglutamine_TMS_28	CC(CCC(=O)N(C(CCC(=O)N[Si](C)(C)C)C(=O)O)[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard polar	2025-10-24	3507.01
Gas Chromatography	Deoxycholylglutamine_TMS_29	CC(CCC(=O)NC(CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard polar	2025-10-24	2111.41
Gas Chromatography	Deoxycholylglutamine_TMS_30	CC(CCC(=O)N(C(CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O)[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C	standard polar	2025-10-24	462.122
Gas Chromatography	Deoxycholylglutamine_TMS_31	CC(CCC(=O)NC(CCC(=O)N[Si](C)(C)C)C(=O)O[Si](C)(C)C)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard polar	2025-10-24	1871.65
Gas Chromatography	Deoxycholylglutamine_TMS_32	CC(CCC(=O)N(C(CCC(N)=O)C(=O)O[Si](C)(C)C)[Si](C)(C)C)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard polar	2025-10-24	2448.6
Gas Chromatography	Deoxycholylglutamine_TMS_33	CC(CCC(=O)N(C(CCC(=O)N[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O)C12C	standard polar	2025-10-24	-48.6938
Gas Chromatography	Deoxycholylglutamine_TMS_34	CC(CCC(=O)NC(CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O)C12C	standard polar	2025-10-24	1627.72
Gas Chromatography	Deoxycholylglutamine_TMS_35	CC(CCC(=O)N(C(CCC(=O)N[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard polar	2025-10-24	2170.65
Gas Chromatography	Deoxycholylglutamine_TMS_36	CC(CCC(=O)NC(CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard polar	2025-10-24	1544.32
Gas Chromatography	Deoxycholylglutamine_TMS_37	CC(CCC(=O)N(C(CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C	standard polar	2025-10-24	2052.18
Gas Chromatography	Deoxycholylglutamine_TMS_38	CC(CCC(=O)N(C(CCC(=O)N[Si](C)(C)C)C(=O)O)[Si](C)(C)C)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard polar	2025-10-24	1549.14
Gas Chromatography	Deoxycholylglutamine_TMS_39	CC(CCC(=O)NC(CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard polar	2025-10-24	2132.57
Gas Chromatography	Deoxycholylglutamine_TMS_40	CC(CCC(=O)N(C(CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O)[Si](C)(C)C)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O)C12C	standard polar	2025-10-24	1912.4
Gas Chromatography	Deoxycholylglutamine_TMS_41	CC(CCC(=O)N(C(CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O)[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard polar	2025-10-24	1423.74
Gas Chromatography	Deoxycholylglutamine_TMS_42	CC(CCC(=O)N(C(CCC(=O)N[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard polar	2025-10-24	2467.97
Gas Chromatography	Deoxycholylglutamine_TMS_43	CC(CCC(=O)NC(CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard polar	2025-10-24	2212.33
Gas Chromatography	Deoxycholylglutamine_TMS_44	CC(CCC(=O)N(C(CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O)C12C	standard polar	2025-10-24	3179.96
Gas Chromatography	Deoxycholylglutamine_TMS_45	CC(CCC(=O)N(C(CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard polar	2025-10-24	3559.68
Gas Chromatography	Deoxycholylglutamine_TMS_46	CC(CCC(=O)N(C(CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O)[Si](C)(C)C)C1CCC2C3CCC4CC(O[Si](C)(C)C)CCC4(C)C3CC(O[Si](C)(C)C)C12C	standard polar	2025-10-24	1544.01

Biological Properties

Cellular Locations

Extracellular

Biospecimen Locations

Intestine

Tissue Locations

Intestine

Associated OMIM IDs

114500 (Colorectal cancer)
610247 (Eosinophilic esophagitis)

Human Proteins and Enzymes

Protein ID	Protein Name	Protein Type	Uniprot ID	Species

Human Pathways

Pathways

Name	SMPDB/PathBank

Microbial Pathways

Pathways

Not Available

Metabolic Reactions

Reactions

This table shows at most 20 reactions. For the full list of associated reactions:

See All Associated Reactions

Reaction ID	Precursor	Product	Enzyme	Reaction Type	Data Source	Reference

Health Effects and Bioactivity

Health Outcome/Bioactivity	Metabolite Response/Effect	Evidence Type	Host and Biospecimen	Data Source	Reference

Microbial Sources

Superkingdom/Kingdom	Phylum	Total species	Hosts and Body Sites	Microbial Links
Bacteria/Eubacteria	Actinobacteria	1	Human ; Human feces
Bacteria/Eubacteria	Firmicutes	3	Human feces; Human ; Human urine

Exposure Sources

Other Exposures

Source Type	Data Source	Reference

Host Biospecimen and Location

Host and Biospecimen	Status	Mean	Std	Min	Max	Units	Age	Sex	Health Condition	Data Source	Reference
Human Intestine	Detected but not Quantified						Not Specified	Not Specified	Normal	HMDB	34986597

External Links

HMDB ID

HMDB0242440

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

Not Available

KNApSAcK ID

Not Available

Chemspider ID

Not Available

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

156963149

PDB ID

Not Available

ChEBI ID

Not Available

Food Biomarker Ontology

Not Available

CMMC Knowledgebase

Not Available

General References

Guzior DV, Quinn RA: Review: microbial transformations of human bile acids. Microbiome. 2021 Jun 14;9(1):140. doi: 10.1186/s40168-021-01101-1. [PubMed:34127070 ]
Quinn RA, Melnik AV, Vrbanac A, Fu T, Patras KA, Christy MP, Bodai Z, Belda-Ferre P, Tripathi A, Chung LK, Downes M, Welch RD, Quinn M, Humphrey G, Panitchpakdi M, Weldon KC, Aksenov A, da Silva R, Avila-Pacheco J, Clish C, Bae S, Mallick H, Franzosa EA, Lloyd-Price J, Bussell R, Thron T, Nelson AT, Wang M, Leszczynski E, Vargas F, Gauglitz JM, Meehan MJ, Gentry E, Arthur TD, Komor AC, Poulsen O, Boland BS, Chang JT, Sandborn WJ, Lim M, Garg N, Lumeng JC, Xavier RJ, Kazmierczak BI, Jain R, Egan M, Rhee KE, Ferguson D, Raffatellu M, Vlamakis H, Haddad GG, Siegel D, Huttenhower C, Mazmanian SK, Evans RM, Nizet V, Knight R, Dorrestein PC: Global chemical effects of the microbiome include new bile-acid conjugations. Nature. 2020 Mar;579(7797):123-129. doi: 10.1038/s41586-020-2047-9. Epub 2020 Feb 26. [PubMed:32103176 ]

Showing metabocard for Deoxycholylglutamine (MMDBc0057274)

MOL for #<Metabolite:0x00007fc929c3a628>

3D MOL for #<Metabolite:0x00007fc929c3a628>

3D SDF for #<Metabolite:0x00007fc929c3a628>

3D-SDF for #<Metabolite:0x00007fc929c3a628>

PDB for #<Metabolite:0x00007fc929c3a628>

3D PDB for #<Metabolite:0x00007fc929c3a628>

SMILES for #<Metabolite:0x00007fc929c3a628>

INCHI for #<Metabolite:0x00007fc929c3a628>

Structure for #<Metabolite:0x00007fc929c3a628>

3D Structure for #<Metabolite:0x00007fc929c3a628>