Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-06-17 19:51:15 UTC
Update Date2025-10-07 16:09:06 UTC
Metabolite IDMMDBc0055404
Metabolite Identification
Common Name3-oxoadipate
Description3-oxoadipate is a dicarboxylic acid derivative belonging to the chemical class of keto acids. It is characterized by a six-carbon backbone with two carboxyl groups and a ketone functional group, which plays a crucial role in various metabolic pathways. In microbial metabolism, 3-oxoadipate is an intermediate in the degradation of aromatic compounds, particularly in the ortho- and meta-cleavage pathways. For instance, it is formed during the conversion of 3-chlorocatechol, which is derived from 3-chlorobenzoate, as detailed in the literature (PMID:38488372 ). Additionally, it participates in the metabolic engineering of strains to enhance the shikimate and β-ketoadipic acid pathways, where the 3-oxoadipate CoA-transferase gene is often targeted to prevent the loss of biosynthetic intermediates (PMID:39343057 ). The yeast Candida parapsilosis utilizes both the 3-oxoadipate and gentisate pathways, with specific gene clusters encoding the necessary enzymes and transporters that are upregulated in a substrate-specific manner (PMID:35255079 ). Furthermore, the detection of 3-oxoadipate indicates the coexistence of dual metabolic pathways for phenol degradation in certain strains (PMID:37651933 ).
Structure
Synonyms
ValueSource
3-Keto-adipateChEBI
3-Keto-adipic acidGenerator
3-Oxoadipic acidGenerator
Molecular FormulaC6H6O5
Average Mass158.11
Monoisotopic Mass158.022620453
IUPAC Name3-oxohexanedioate
Traditional Nameβ-ketoadipate
CAS Registry NumberNot Available
SMILES
[O-]C(=O)CCC(=O)CC([O-])=O
InChI Identifier
InChI=1S/C6H8O5/c7-4(3-6(10)11)1-2-5(8)9/h1-3H2,(H,8,9)(H,10,11)/p-2
InChI KeyRTGHRDFWYQHVFW-UHFFFAOYSA-L