Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-06-17 19:46:33 UTC
Update Date2025-10-07 16:09:01 UTC
Metabolite IDMMDBc0055215
Metabolite Identification
Common Name2-dehydro-3-deoxy-L-arabinonate
Description2-dehydro-3-deoxy-L-arabinonate is a carbohydrate derivative belonging to the class of organic compounds known as sugar acids. Its chemical structure features a dehydro and deoxy modification of the L-arabinose sugar backbone, which plays a role in various metabolic pathways. Specifically, 2-dehydro-3-deoxy-L-arabinonate is produced through the enzymatic action of L-arabinonate dehydratase, which catalyzes the conversion of L-arabinonate, a precursor in the pentose phosphate pathway, to this metabolite (PMID:28574691 ). Additionally, it is involved in the broader context of carbohydrate metabolism, where D-xylonate dehydratase catalyzes the dehydration of D-xylonate to yield 2-dehydro-3-deoxy-D-xylonate, highlighting its role in the interconversion of sugar acids (PMID:27487924 ). These transformations indicate its significance in the metabolic pathways that process pentose sugars, which are crucial for various biological processes, including nucleotide synthesis and energy production.
Structure
Synonyms
ValueSource
2-Dehydro-3-deoxy-L-arabinonic acidGenerator
Molecular FormulaC5H7O5
Average Mass147.107
Monoisotopic Mass147.029896905
IUPAC Name(4R)-4,5-dihydroxy-2-oxopentanoate
Traditional Name2-dehydro-3-deoxy-L-pentonate
CAS Registry NumberNot Available
SMILES
[H][C@](O)(CO)CC(=O)C([O-])=O
InChI Identifier
InChI=1S/C5H8O5/c6-2-3(7)1-4(8)5(9)10/h3,6-7H,1-2H2,(H,9,10)/p-1/t3-/m1/s1
InChI KeyUQIGQRSJIKIPKZ-GSVOUGTGSA-M