Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-05-16 21:19:16 UTC
Update Date2025-10-07 16:08:18 UTC
Metabolite IDMMDBc0053272
Metabolite Identification
Common Namegibberellin A1
DescriptionGibberellin A1 is a diterpenoid, specifically a member of the gibberellin class of plant hormones. Its chemical structure features a complex bicyclic framework with a characteristic 19-carbon skeleton, which includes a lactone ring and several hydroxyl groups that are crucial for its biological activity. Gibberellin A1 is involved in various signaling pathways that regulate fundamental plant processes. For instance, it plays a pivotal role in seed germination, root elongation, and the promotion of flower and fruit production through its interaction with the GCR1 plant G-protein-coupled receptor (PMID:40388663 ). Additionally, it has been shown to influence shoot growth in species like Dendrocalamus sinicus, where it interacts with gibberellin-related genes such as KAO and SLRL1 to promote rapid growth (PMID:40041567 ). Furthermore, gibberellin A1 is recognized as a key factor alongside other phytohormones in various physiological responses, including filament elongation and the regulation of metabolite levels in plants (PMIDs:39681145, 38675697, 37893714). Its diverse roles underscore its significance in plant development and adaptation.
Structure
SynonymsNot Available
Molecular FormulaC19H23O6
Average Mass347.388
Monoisotopic Mass347.150012041
IUPAC Name(1R,2R,5S,8S,9S,10R,11R,12S)-5,12-dihydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.1^{5,8}.0^{1,10}.0^{2,8}]heptadecane-9-carboxylate
Traditional Name(1R,2R,5S,8S,9S,10R,11R,12S)-5,12-dihydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.1^{5,8}.0^{1,10}.0^{2,8}]heptadecane-9-carboxylate
CAS Registry NumberNot Available
SMILES
C[C@@]12[C@H]3[C@H](C([O-])=O)[C@@]45CC(=C)[C@@](O)(C4)CC[C@H]5[C@@]3(CC[C@@H]1O)OC2=O
InChI Identifier
InChI=1S/C19H24O6/c1-9-7-17-8-18(9,24)5-3-10(17)19-6-4-11(20)16(2,15(23)25-19)13(19)12(17)14(21)22/h10-13,20,24H,1,3-8H2,2H3,(H,21,22)/p-1/t10-,11+,12-,13-,16+,17+,18+,19-/m1/s1
InChI KeyJLJLRLWOEMWYQK-SNTJWBGVSA-M