MiMeDB: Showing metabocard for PGP(18:1(9Z)/18:1(11Z)) (MMDBc0046273)

Microbial

Human

Record Information

Version

2.0

Status

Detected and Quantified

Creation Date

2021-11-19 14:28:38 UTC

Update Date

2024-04-30 20:24:50 UTC

Metabolite ID

MMDBc0046273

Metabolite Identification

Common Name

PGP(18:1(9Z)/18:1(11Z))

Description

PGP(18:1(9Z)/18:1(11Z)) is a phosphatidylglycerolphosphate or glycerophospholipid (PGP or GP). It is a glycerophospholipid in which a phosphoglycerol moiety occupies a glycerol substitution site followed by another phosphate moiety. As is the case with diacylglycerols, phosphatidylglycerols can have many different combinations of fatty acids of varying lengths and saturation attached at the C-1 and C-2 positions. Fatty acids containing 16, 18 and 20 carbons are the most common. PGP(18:1(9Z)/18:1(11Z)), in particular, consists of one chain of oleic acid at the C-1 position and one chain of vaccenic acid at the C-2 position. The oleic acid moiety is derived from vegetable oils, especially olive and canola oil, while the vaccenic acid moiety is derived from butter fat and animal fat. Phosphatidylglycerolphosphate is present at a level of 1-2% in most animal tissues, but it can be the second most abundant phospholipid in lung surfactant at up to 11% of the total. It is well established that the concentration of Phosphatidylglycerolphosphate increases during fetal development. Phosphatidylglycerolphosphate may be present in animal tissues merely as a precursor for diphosphatidylglycerol (cardiolipin). Phosphatidylglycerol is formed from phosphatidic acid by a sequence of enzymatic reactions that proceeds via the intermediate, cytidine diphosphate diacylglycerol (CDP-diacylglycerol). Bioynthesis proceeds by condensation of phosphatidic acid and cytidine triphosphate with elimination of pyrophosphate via the action of phosphatidate cytidyltransferase (or CDP-synthase). CDP-diacylglycerol then reacts with glycerol-3-phosphate via phosphatidylglycerophosphate synthase to form 3-sn-phosphatidyl-1'-sn-glycerol 3'-phosphoric acid, with the release of cytidine monophosphate (CMP). Finally, phosphatidylglycerol is formed by the action of specific phosphatases. While most phospholipids have a saturated fatty acid on C-1 and an unsaturated fatty acid on C-2 of the glycerol backbone, the fatty acid distribution at the C-1 and C-2 positions of glycerol within phospholipids is continually in flux, owing to phospholipid degradation and the continuous phospholipid remodeling that occurs while these molecules are in membranes. PGPs have a net charge of -1 at physiological pH and are found in high concentration in mitochondrial membranes and as components of pulmonary surfactant. PGP also serves as a precursor for the synthesis of cardiolipin. PGP is synthesized from CDP-diacylglycerol and glycerol-3-phosphate.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI


  Mrv1652303302020132D          

137136  0  0  1  0            999 V2000
   21.5850   -3.1878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9098   -3.5775    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   20.2347   -3.1878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2601   -3.5775    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.5596   -3.5775    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.3830   -4.3571    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.9352   -3.1878    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   22.5455   -2.5126    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.3250   -3.8628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.6103   -2.7980    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.2854   -3.1878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9606   -2.7980    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   25.6357   -3.1878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4976   -4.3868    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   26.2735   -2.7612    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.5369   -2.1130    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   24.3485   -2.1130    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6989   -3.1650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4134   -3.5776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1279   -3.1650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8423   -3.5775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5568   -3.1650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2713   -3.5775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9858   -3.1650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7003   -3.5775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4147   -3.1650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1292   -3.1651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8437   -3.5776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5582   -3.1651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2727   -3.5776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9872   -3.1651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7017   -3.5776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4162   -3.1651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1306   -3.5776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8451   -3.1651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8451   -2.3400    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5224   -4.7696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2369   -4.3570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9513   -4.7696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6658   -4.3571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3803   -4.7696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0948   -4.3571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8093   -4.7696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5237   -4.7695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2382   -4.3570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9527   -4.7695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6672   -4.3570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3817   -4.7695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0962   -4.3570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8107   -4.7695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5251   -4.3570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2396   -4.7695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9541   -4.3570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6685   -4.7695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6685   -5.5946    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.0136   -3.1258    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   27.7537   -3.4905    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.3782   -2.3858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.6490   -3.8659    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.2441   -2.3770    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   21.9767   -2.3978    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   20.6559   -2.4076    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   19.9700   -2.2866    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   23.1220   -4.7334    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   24.0875   -4.1432    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   24.7581   -3.9443    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   25.3406   -4.0052    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   26.0720   -3.9430    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   24.5114   -1.2389    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8369   -2.2788    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.0070   -2.5549    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.7888   -3.2670    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.5105   -4.2898    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1617   -4.4469    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.5720   -2.3090    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.3941   -2.1573    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.6613   -4.3295    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.1878   -4.3060    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.1464   -2.2055    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.8810   -2.1971    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.1229   -4.3291    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.6450   -4.2849    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.5968   -2.1602    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.3252   -2.2347    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.6211   -4.3364    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.2467   -4.2566    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.2743   -2.1991    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.1542   -2.1469    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.6587   -4.3339    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.1776   -4.3294    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.2580   -2.1995    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.9267   -2.1725    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   15.1159   -4.3259    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   15.6258   -4.3084    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   15.6388   -2.1863    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   16.3583   -2.1796    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   16.5451   -4.3396    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.0711   -4.2870    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.0781   -2.1683    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.7494   -2.1754    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.9929   -4.3494    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   18.5262   -4.2986    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8813   -3.9730    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6478   -5.3474    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.7432   -5.6982    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.7878   -3.8082    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.3345   -3.5940    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.4578   -5.6716    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.2309   -5.7669    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.2975   -3.6562    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.8210   -3.6048    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.9739   -5.7501    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.6517   -5.7392    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.7568   -3.6107    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.2795   -3.5956    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.7785   -5.7863    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.6583   -5.7346    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.6888   -3.6771    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.3150   -3.5966    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.5923   -5.7020    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.3300   -5.7619    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.2922   -3.6611    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.8143   -3.5974    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   15.0197   -5.7234    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   15.7494   -5.7736    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   15.7358   -3.6471    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   16.2513   -3.6041    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   16.4870   -5.7517    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.2085   -5.7284    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.1717   -3.6401    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.6881   -3.6029    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.9247   -5.7770    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   18.6618   -5.6691    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   18.6160   -3.6249    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   19.1479   -3.6231    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   28.2343   -2.2398    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   27.3722   -4.4199    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  1  1  0  0  0  0
  5  3  1  0  0  0  0
  2  6  1  6  0  0  0
  7  4  1  0  0  0  0
  8  7  2  0  0  0  0
  9  7  1  0  0  0  0
 10  7  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  1  0  0  0  0
  2 14  1  1  0  0  0
 13 15  1  0  0  0  0
 12 16  1  6  0  0  0
 12 17  1  1  0  0  0
 19 18  1  0  0  0  0
 20 19  1  0  0  0  0
 21 20  1  0  0  0  0
 22 21  1  0  0  0  0
 23 22  1  0  0  0  0
 24 23  1  0  0  0  0
 25 24  1  0  0  0  0
 26 25  1  0  0  0  0
 27 26  2  0  0  0  0
 28 27  1  0  0  0  0
 29 28  1  0  0  0  0
 30 29  1  0  0  0  0
 31 30  1  0  0  0  0
 32 31  1  0  0  0  0
 33 32  1  0  0  0  0
 34 33  1  0  0  0  0
 35 34  1  0  0  0  0
 36 35  2  0  0  0  0
  5 35  1  0  0  0  0
 38 37  1  0  0  0  0
 39 38  1  0  0  0  0
 40 39  1  0  0  0  0
 41 40  1  0  0  0  0
 42 41  1  0  0  0  0
 43 42  1  0  0  0  0
 44 43  2  0  0  0  0
 45 44  1  0  0  0  0
 46 45  1  0  0  0  0
 47 46  1  0  0  0  0
 48 47  1  0  0  0  0
 49 48  1  0  0  0  0
 50 49  1  0  0  0  0
 51 50  1  0  0  0  0
 52 51  1  0  0  0  0
 53 52  1  0  0  0  0
 54 53  1  0  0  0  0
 55 54  2  0  0  0  0
  6 54  1  0  0  0  0
 57 56  2  0  0  0  0
 58 56  1  0  0  0  0
 59 56  1  0  0  0  0
 15 56  1  0  0  0  0
  1 60  1  0  0  0  0
  1 61  1  0  0  0  0
  3 62  1  0  0  0  0
  3 63  1  0  0  0  0
  9 64  1  0  0  0  0
 11 65  1  0  0  0  0
 11 66  1  0  0  0  0
 13 67  1  0  0  0  0
 13 68  1  0  0  0  0
 17 69  1  0  0  0  0
 18 70  1  0  0  0  0
 18 71  1  0  0  0  0
 18 72  1  0  0  0  0
 19 73  1  0  0  0  0
 19 74  1  0  0  0  0
 20 75  1  0  0  0  0
 20 76  1  0  0  0  0
 21 77  1  0  0  0  0
 21 78  1  0  0  0  0
 22 79  1  0  0  0  0
 22 80  1  0  0  0  0
 23 81  1  0  0  0  0
 23 82  1  0  0  0  0
 24 83  1  0  0  0  0
 24 84  1  0  0  0  0
 25 85  1  0  0  0  0
 25 86  1  0  0  0  0
 26 87  1  0  0  0  0
 27 88  1  0  0  0  0
 28 89  1  0  0  0  0
 28 90  1  0  0  0  0
 29 91  1  0  0  0  0
 29 92  1  0  0  0  0
 30 93  1  0  0  0  0
 30 94  1  0  0  0  0
 31 95  1  0  0  0  0
 31 96  1  0  0  0  0
 32 97  1  0  0  0  0
 32 98  1  0  0  0  0
 33 99  1  0  0  0  0
 33100  1  0  0  0  0
 34101  1  0  0  0  0
 34102  1  0  0  0  0
 37103  1  0  0  0  0
 37104  1  0  0  0  0
 37105  1  0  0  0  0
 38106  1  0  0  0  0
 38107  1  0  0  0  0
 39108  1  0  0  0  0
 39109  1  0  0  0  0
 40110  1  0  0  0  0
 40111  1  0  0  0  0
 41112  1  0  0  0  0
 41113  1  0  0  0  0
 42114  1  0  0  0  0
 42115  1  0  0  0  0
 43116  1  0  0  0  0
 44117  1  0  0  0  0
 45118  1  0  0  0  0
 45119  1  0  0  0  0
 46120  1  0  0  0  0
 46121  1  0  0  0  0
 47122  1  0  0  0  0
 47123  1  0  0  0  0
 48124  1  0  0  0  0
 48125  1  0  0  0  0
 49126  1  0  0  0  0
 49127  1  0  0  0  0
 50128  1  0  0  0  0
 50129  1  0  0  0  0
 51130  1  0  0  0  0
 51131  1  0  0  0  0
 52132  1  0  0  0  0
 52133  1  0  0  0  0
 53134  1  0  0  0  0
 53135  1  0  0  0  0
 58136  1  0  0  0  0
 59137  1  0  0  0  0
M  END

HMDB0013535
     RDKit          3D
PGP(18:1(9Z)/18:1(11Z))
137136  0  0  0  0  0  0  0  0999 V2000
   -8.8350    0.7256    0.6568 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3685    0.7155    0.3330 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9936   -0.4801   -0.5612 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5319   -0.3547   -0.8037 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9010   -1.4027   -1.6539 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0137   -2.8035   -1.0973 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4079   -2.9798    0.2035 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4419   -3.7886    0.4799 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8089   -4.6690   -0.5198 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3804   -4.2432   -0.5990 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5125   -5.0232   -1.5507 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8374   -4.3445   -1.4921 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8835   -4.9471   -2.3693 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1376   -4.0780   -2.2656 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2484   -4.5318   -3.1217 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9240   -5.8147   -2.9558 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7261   -6.0028   -1.7457 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2331   -6.0483   -0.3974 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0098   -7.2163    0.1486 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9500   -5.0112    0.4742 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5349   -5.1629    1.8094 C   0  0  2  0  0  0  0  0  0  0  0  0
    3.1259   -4.9047    2.1386 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5816   -3.6554    1.8316 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2564   -3.4649    2.2438 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7124   -4.4418    2.8732 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4375   -2.2917    2.0341 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6724   -1.1314    2.9405 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2943    0.0024    2.6389 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1795    0.4776    1.2315 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1687    1.6157    0.9436 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9988    2.0126   -0.5046 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9428    3.1513   -0.9089 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6569    3.4136   -2.3204 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2107    4.5736   -2.7746 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9666    5.6904   -1.8802 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7174    6.9245   -2.0046 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6403    7.8017   -3.1804 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0949    7.3248   -4.5020 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0301    8.2542   -5.6516 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8482    9.4615   -5.7692 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7680   10.5169   -4.7403 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6350   11.7386   -5.1699 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5449   -4.5413    2.7590 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7076   -3.1849    2.4971 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8323   -2.5135    3.5492 P   0  0  0  0  0  5  0  0  0  0  0  0
    6.8719   -3.2533    4.8783 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3939   -2.6608    2.8774 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4792   -0.8996    3.8880 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0674   -0.4709    5.0917 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6949    0.9753    5.3614 C   0  0  1  0  0  0  0  0  0  0  0  0
    7.1952    1.7389    4.3067 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1943    1.1201    5.4812 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8252    2.4256    5.7020 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1439    2.5898    5.8146 P   0  0  0  0  0  5  0  0  0  0  0  0
    2.5107    1.4220    6.5250 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5651    2.5532    4.2042 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6586    4.0267    6.5104 O   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0504    1.7412    1.1001 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1490   -0.0170    1.3931 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.4375    0.6944   -0.2839 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0849    1.6748   -0.1076 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8209    0.6371    1.3168 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6196   -0.4419   -1.4536 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1957   -1.3755    0.0811 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0514   -0.3302    0.2248 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3299    0.6580   -1.2038 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4447   -1.4191   -2.6221 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8651   -1.0895   -1.8884 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1391   -2.9875   -1.0852 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6619   -3.4720   -1.8992 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7993   -2.3725    1.0396 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0317   -3.8717    1.4997 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7939   -5.7105   -0.0486 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3148   -4.8098   -1.4585 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3353   -3.1813   -0.8806 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9203   -4.3518    0.4142 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9307   -4.8440   -2.5857 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4791   -6.0952   -1.3720 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.6539   -3.2696   -1.6918 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1844   -4.3865   -0.4252 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5701   -5.0885   -3.3962 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1691   -5.9250   -1.9231 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7811   -3.0893   -2.7450 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3821   -3.8766   -1.2133 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0088   -3.6603   -3.0982 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8724   -4.3988   -4.2056 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2140   -6.6991   -3.1005 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6252   -5.9154   -3.8696 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6291   -5.2467   -1.7695 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3431   -6.9692   -1.8952 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6449   -6.3063    2.0089 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5141   -5.7227    1.6714 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0204   -5.0723    3.2578 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5906   -1.9948    0.9430 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6547   -2.6041    2.0410 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7136   -0.8093    2.8871 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4908   -1.4488    3.9834 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0090    0.8335    3.3051 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3010   -0.3316    2.9454 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2973   -0.3158    0.4610 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8324    0.9157    1.1041 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1693    1.2707    1.1859 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8291    2.4678    1.5651 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0303    2.3640   -0.7011 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2211    1.0990   -1.1185 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8856    3.9615   -0.2055 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9793    2.7167   -0.7713 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8154    2.6095   -3.0761 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0050    4.6114   -3.8667 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1487    6.0020   -2.1347 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8583    5.3889   -0.8028 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8475    6.7246   -1.8289 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4168    7.5738   -1.0973 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5533    8.1764   -3.3213 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1491    8.7712   -2.9339 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1363    6.9047   -4.4245 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4925    6.4092   -4.8135 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9277    8.5383   -5.7987 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2425    7.6417   -6.6123 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9512    9.2015   -5.9375 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6328   10.0027   -6.7650 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3003   10.2351   -3.7740 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7780   10.8767   -4.5129 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0389   12.2249   -5.9508 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5742   11.3995   -5.6273 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7514   12.3980   -4.3135 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.5042   -5.1046    2.6138 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2284   -4.7080    3.8039 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.4135   -2.3069    1.9544 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7433   -1.1498    5.8815 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.1625   -0.5709    4.9385 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1899    1.3000    6.2871 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6183    2.5540    4.1624 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9001    0.5396    6.3946 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6715    0.6164    4.6444 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3664    3.4560    3.8686 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7836    3.8449    6.9608 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 24 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
 41 42  1  0
 21 43  1  0
 43 44  1  0
 44 45  1  0
 45 46  2  0
 45 47  1  0
 45 48  1  0
 48 49  1  0
 49 50  1  0
 50 51  1  0
 50 52  1  0
 52 53  1  0
 53 54  1  0
 54 55  2  0
 54 56  1  0
 54 57  1  0
  1 58  1  0
  1 59  1  0
  1 60  1  0
  2 61  1  0
  2 62  1  0
  3 63  1  0
  3 64  1  0
  4 65  1  0
  4 66  1  0
  5 67  1  0
  5 68  1  0
  6 69  1  0
  6 70  1  0
  7 71  1  0
  8 72  1  0
  9 73  1  0
  9 74  1  0
 10 75  1  0
 10 76  1  0
 11 77  1  0
 11 78  1  0
 12 79  1  0
 12 80  1  0
 13 81  1  0
 13 82  1  0
 14 83  1  0
 14 84  1  0
 15 85  1  0
 15 86  1  0
 16 87  1  0
 16 88  1  0
 17 89  1  0
 17 90  1  0
 21 91  1  1
 22 92  1  0
 22 93  1  0
 26 94  1  0
 26 95  1  0
 27 96  1  0
 27 97  1  0
 28 98  1  0
 28 99  1  0
 29100  1  0
 29101  1  0
 30102  1  0
 30103  1  0
 31104  1  0
 31105  1  0
 32106  1  0
 32107  1  0
 33108  1  0
 34109  1  0
 35110  1  0
 35111  1  0
 36112  1  0
 36113  1  0
 37114  1  0
 37115  1  0
 38116  1  0
 38117  1  0
 39118  1  0
 39119  1  0
 40120  1  0
 40121  1  0
 41122  1  0
 41123  1  0
 42124  1  0
 42125  1  0
 42126  1  0
 43127  1  0
 43128  1  0
 47129  1  0
 49130  1  0
 49131  1  0
 50132  1  1
 51133  1  0
 52134  1  0
 52135  1  0
 56136  1  0
 57137  1  0
M  END


  Mrv1652303302020132D          

137136  0  0  1  0            999 V2000
   21.5850   -3.1878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9098   -3.5775    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   20.2347   -3.1878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2601   -3.5775    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.5596   -3.5775    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.3830   -4.3571    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.9352   -3.1878    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   22.5455   -2.5126    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.3250   -3.8628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.6103   -2.7980    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.2854   -3.1878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9606   -2.7980    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   25.6357   -3.1878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4976   -4.3868    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   26.2735   -2.7612    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.5369   -2.1130    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   24.3485   -2.1130    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6989   -3.1650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4134   -3.5776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1279   -3.1650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8423   -3.5775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5568   -3.1650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2713   -3.5775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9858   -3.1650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7003   -3.5775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4147   -3.1650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1292   -3.1651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8437   -3.5776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5582   -3.1651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2727   -3.5776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9872   -3.1651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7017   -3.5776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4162   -3.1651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1306   -3.5776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8451   -3.1651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8451   -2.3400    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5224   -4.7696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2369   -4.3570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9513   -4.7696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6658   -4.3571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3803   -4.7696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0948   -4.3571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8093   -4.7696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5237   -4.7695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2382   -4.3570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9527   -4.7695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6672   -4.3570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3817   -4.7695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0962   -4.3570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8107   -4.7695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5251   -4.3570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2396   -4.7695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9541   -4.3570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6685   -4.7695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6685   -5.5946    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.0136   -3.1258    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   27.7537   -3.4905    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.3782   -2.3858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.6490   -3.8659    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.2441   -2.3770    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   21.9767   -2.3978    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   20.6559   -2.4076    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   19.9700   -2.2866    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   23.1220   -4.7334    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   24.0875   -4.1432    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   24.7581   -3.9443    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   25.3406   -4.0052    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   26.0720   -3.9430    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   24.5114   -1.2389    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8369   -2.2788    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.0070   -2.5549    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.7888   -3.2670    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.5105   -4.2898    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1617   -4.4469    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.5720   -2.3090    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.3941   -2.1573    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.6613   -4.3295    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.1878   -4.3060    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.1464   -2.2055    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.8810   -2.1971    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.1229   -4.3291    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.6450   -4.2849    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.5968   -2.1602    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.3252   -2.2347    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.6211   -4.3364    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.2467   -4.2566    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.2743   -2.1991    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.1542   -2.1469    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.6587   -4.3339    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.1776   -4.3294    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.2580   -2.1995    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.9267   -2.1725    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   15.1159   -4.3259    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   15.6258   -4.3084    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   15.6388   -2.1863    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   16.3583   -2.1796    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   16.5451   -4.3396    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.0711   -4.2870    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.0781   -2.1683    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.7494   -2.1754    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.9929   -4.3494    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   18.5262   -4.2986    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8813   -3.9730    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6478   -5.3474    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.7432   -5.6982    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.7878   -3.8082    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.3345   -3.5940    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.4578   -5.6716    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.2309   -5.7669    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.2975   -3.6562    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.8210   -3.6048    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.9739   -5.7501    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.6517   -5.7392    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.7568   -3.6107    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.2795   -3.5956    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.7785   -5.7863    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.6583   -5.7346    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.6888   -3.6771    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.3150   -3.5966    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.5923   -5.7020    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.3300   -5.7619    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.2922   -3.6611    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.8143   -3.5974    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   15.0197   -5.7234    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   15.7494   -5.7736    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   15.7358   -3.6471    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   16.2513   -3.6041    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   16.4870   -5.7517    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.2085   -5.7284    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.1717   -3.6401    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.6881   -3.6029    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.9247   -5.7770    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   18.6618   -5.6691    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   18.6160   -3.6249    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   19.1479   -3.6231    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   28.2343   -2.2398    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   27.3722   -4.4199    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  1  1  0  0  0  0
  5  3  1  0  0  0  0
  2  6  1  6  0  0  0
  7  4  1  0  0  0  0
  8  7  2  0  0  0  0
  9  7  1  0  0  0  0
 10  7  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  1  0  0  0  0
  2 14  1  1  0  0  0
 13 15  1  0  0  0  0
 12 16  1  6  0  0  0
 12 17  1  1  0  0  0
 19 18  1  0  0  0  0
 20 19  1  0  0  0  0
 21 20  1  0  0  0  0
 22 21  1  0  0  0  0
 23 22  1  0  0  0  0
 24 23  1  0  0  0  0
 25 24  1  0  0  0  0
 26 25  1  0  0  0  0
 27 26  2  0  0  0  0
 28 27  1  0  0  0  0
 29 28  1  0  0  0  0
 30 29  1  0  0  0  0
 31 30  1  0  0  0  0
 32 31  1  0  0  0  0
 33 32  1  0  0  0  0
 34 33  1  0  0  0  0
 35 34  1  0  0  0  0
 36 35  2  0  0  0  0
  5 35  1  0  0  0  0
 38 37  1  0  0  0  0
 39 38  1  0  0  0  0
 40 39  1  0  0  0  0
 41 40  1  0  0  0  0
 42 41  1  0  0  0  0
 43 42  1  0  0  0  0
 44 43  2  0  0  0  0
 45 44  1  0  0  0  0
 46 45  1  0  0  0  0
 47 46  1  0  0  0  0
 48 47  1  0  0  0  0
 49 48  1  0  0  0  0
 50 49  1  0  0  0  0
 51 50  1  0  0  0  0
 52 51  1  0  0  0  0
 53 52  1  0  0  0  0
 54 53  1  0  0  0  0
 55 54  2  0  0  0  0
  6 54  1  0  0  0  0
 57 56  2  0  0  0  0
 58 56  1  0  0  0  0
 59 56  1  0  0  0  0
 15 56  1  0  0  0  0
  1 60  1  0  0  0  0
  1 61  1  0  0  0  0
  3 62  1  0  0  0  0
  3 63  1  0  0  0  0
  9 64  1  0  0  0  0
 11 65  1  0  0  0  0
 11 66  1  0  0  0  0
 13 67  1  0  0  0  0
 13 68  1  0  0  0  0
 17 69  1  0  0  0  0
 18 70  1  0  0  0  0
 18 71  1  0  0  0  0
 18 72  1  0  0  0  0
 19 73  1  0  0  0  0
 19 74  1  0  0  0  0
 20 75  1  0  0  0  0
 20 76  1  0  0  0  0
 21 77  1  0  0  0  0
 21 78  1  0  0  0  0
 22 79  1  0  0  0  0
 22 80  1  0  0  0  0
 23 81  1  0  0  0  0
 23 82  1  0  0  0  0
 24 83  1  0  0  0  0
 24 84  1  0  0  0  0
 25 85  1  0  0  0  0
 25 86  1  0  0  0  0
 26 87  1  0  0  0  0
 27 88  1  0  0  0  0
 28 89  1  0  0  0  0
 28 90  1  0  0  0  0
 29 91  1  0  0  0  0
 29 92  1  0  0  0  0
 30 93  1  0  0  0  0
 30 94  1  0  0  0  0
 31 95  1  0  0  0  0
 31 96  1  0  0  0  0
 32 97  1  0  0  0  0
 32 98  1  0  0  0  0
 33 99  1  0  0  0  0
 33100  1  0  0  0  0
 34101  1  0  0  0  0
 34102  1  0  0  0  0
 37103  1  0  0  0  0
 37104  1  0  0  0  0
 37105  1  0  0  0  0
 38106  1  0  0  0  0
 38107  1  0  0  0  0
 39108  1  0  0  0  0
 39109  1  0  0  0  0
 40110  1  0  0  0  0
 40111  1  0  0  0  0
 41112  1  0  0  0  0
 41113  1  0  0  0  0
 42114  1  0  0  0  0
 42115  1  0  0  0  0
 43116  1  0  0  0  0
 44117  1  0  0  0  0
 45118  1  0  0  0  0
 45119  1  0  0  0  0
 46120  1  0  0  0  0
 46121  1  0  0  0  0
 47122  1  0  0  0  0
 47123  1  0  0  0  0
 48124  1  0  0  0  0
 48125  1  0  0  0  0
 49126  1  0  0  0  0
 49127  1  0  0  0  0
 50128  1  0  0  0  0
 50129  1  0  0  0  0
 51130  1  0  0  0  0
 51131  1  0  0  0  0
 52132  1  0  0  0  0
 52133  1  0  0  0  0
 53134  1  0  0  0  0
 53135  1  0  0  0  0
 58136  1  0  0  0  0
 59137  1  0  0  0  0
M  END
> <DATABASE_ID>
MMDBc0046273

> <DATABASE_NAME>
MIME

> <SMILES>
[H]O[C@@]([H])(C([H])([H])OP(=O)(O[H])O[H])C([H])([H])OP(=O)(O[H])OC([H])([H])[C@]([H])(OC(=O)C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C(\[H])=C(\[H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H])C([H])([H])OC(=O)C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C(\[H])=C(\[H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H]

> <INCHI_IDENTIFIER>
InChI=1S/C42H80O13P2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-41(44)51-37-40(38-54-57(49,50)53-36-39(43)35-52-56(46,47)48)55-42(45)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h14,16-17,19,39-40,43H,3-13,15,18,20-38H2,1-2H3,(H,49,50)(H2,46,47,48)/b16-14-,19-17-/t39-,40+/m0/s1

> <INCHI_KEY>
HGTCUZQDUITQOP-MYVKIHSOSA-N

> <FORMULA>
C42H80O13P2

> <MOLECULAR_WEIGHT>
855.0243

> <EXACT_MASS>
854.50741567

> <JCHEM_ACCEPTOR_COUNT>
8

> <JCHEM_ATOM_COUNT>
137

> <JCHEM_AVERAGE_POLARIZABILITY>
96.03660152943418

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
4

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
[(2S)-2-hydroxy-3-({hydroxy[(2R)-2-[(11Z)-octadec-11-enoyloxy]-3-[(9Z)-octadec-9-enoyloxy]propoxy]phosphoryl}oxy)propoxy]phosphonic acid

> <ALOGPS_LOGP>
7.47

> <JCHEM_LOGP>
11.867916834666666

> <ALOGPS_LOGS>
-6.15

> <JCHEM_MDDR_LIKE_RULE>
0

> <JCHEM_NUMBER_OF_RINGS>
0

> <JCHEM_PHYSIOLOGICAL_CHARGE>
-3

> <JCHEM_PKA>
2.0402061436989327

> <JCHEM_PKA_STRONGEST_ACIDIC>
1.354879296415124

> <JCHEM_PKA_STRONGEST_BASIC>
-3.410499386302644

> <JCHEM_POLAR_SURFACE_AREA>
195.35

> <JCHEM_REFRACTIVITY>
226.81900000000007

> <JCHEM_ROTATABLE_BOND_COUNT>
44

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
6.01e-04 g/l

> <JCHEM_TRADITIONAL_IUPAC>
(2S)-2-hydroxy-3-{[hydroxy((2R)-2-[(11Z)-octadec-11-enoyloxy]-3-[(9Z)-octadec-9-enoyloxy]propoxy)phosphoryl]oxy}propoxyphosphonic acid

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0013535
     RDKit          3D
PGP(18:1(9Z)/18:1(11Z))
137136  0  0  0  0  0  0  0  0999 V2000
   -8.8350    0.7256    0.6568 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3685    0.7155    0.3330 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9936   -0.4801   -0.5612 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5319   -0.3547   -0.8037 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9010   -1.4027   -1.6539 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0137   -2.8035   -1.0973 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4079   -2.9798    0.2035 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4419   -3.7886    0.4799 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8089   -4.6690   -0.5198 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3804   -4.2432   -0.5990 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5125   -5.0232   -1.5507 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8374   -4.3445   -1.4921 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8835   -4.9471   -2.3693 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1376   -4.0780   -2.2656 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2484   -4.5318   -3.1217 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9240   -5.8147   -2.9558 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7261   -6.0028   -1.7457 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2331   -6.0483   -0.3974 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0098   -7.2163    0.1486 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9500   -5.0112    0.4742 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5349   -5.1629    1.8094 C   0  0  2  0  0  0  0  0  0  0  0  0
    3.1259   -4.9047    2.1386 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5816   -3.6554    1.8316 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2564   -3.4649    2.2438 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7124   -4.4418    2.8732 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4375   -2.2917    2.0341 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6724   -1.1314    2.9405 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2943    0.0024    2.6389 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1795    0.4776    1.2315 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1687    1.6157    0.9436 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9988    2.0126   -0.5046 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9428    3.1513   -0.9089 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6569    3.4136   -2.3204 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2107    4.5736   -2.7746 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9666    5.6904   -1.8802 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7174    6.9245   -2.0046 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6403    7.8017   -3.1804 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0949    7.3248   -4.5020 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0301    8.2542   -5.6516 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8482    9.4615   -5.7692 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7680   10.5169   -4.7403 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6350   11.7386   -5.1699 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5449   -4.5413    2.7590 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7076   -3.1849    2.4971 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8323   -2.5135    3.5492 P   0  0  0  0  0  5  0  0  0  0  0  0
    6.8719   -3.2533    4.8783 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3939   -2.6608    2.8774 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4792   -0.8996    3.8880 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0674   -0.4709    5.0917 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6949    0.9753    5.3614 C   0  0  1  0  0  0  0  0  0  0  0  0
    7.1952    1.7389    4.3067 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1943    1.1201    5.4812 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8252    2.4256    5.7020 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1439    2.5898    5.8146 P   0  0  0  0  0  5  0  0  0  0  0  0
    2.5107    1.4220    6.5250 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5651    2.5532    4.2042 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6586    4.0267    6.5104 O   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0504    1.7412    1.1001 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1490   -0.0170    1.3931 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.4375    0.6944   -0.2839 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0849    1.6748   -0.1076 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8209    0.6371    1.3168 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6196   -0.4419   -1.4536 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1957   -1.3755    0.0811 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0514   -0.3302    0.2248 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3299    0.6580   -1.2038 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4447   -1.4191   -2.6221 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8651   -1.0895   -1.8884 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1391   -2.9875   -1.0852 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6619   -3.4720   -1.8992 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7993   -2.3725    1.0396 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0317   -3.8717    1.4997 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7939   -5.7105   -0.0486 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3148   -4.8098   -1.4585 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3353   -3.1813   -0.8806 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9203   -4.3518    0.4142 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9307   -4.8440   -2.5857 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4791   -6.0952   -1.3720 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.6539   -3.2696   -1.6918 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1844   -4.3865   -0.4252 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5701   -5.0885   -3.3962 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1691   -5.9250   -1.9231 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7811   -3.0893   -2.7450 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3821   -3.8766   -1.2133 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0088   -3.6603   -3.0982 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8724   -4.3988   -4.2056 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2140   -6.6991   -3.1005 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6252   -5.9154   -3.8696 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6291   -5.2467   -1.7695 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3431   -6.9692   -1.8952 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6449   -6.3063    2.0089 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5141   -5.7227    1.6714 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0204   -5.0723    3.2578 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5906   -1.9948    0.9430 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6547   -2.6041    2.0410 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7136   -0.8093    2.8871 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4908   -1.4488    3.9834 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0090    0.8335    3.3051 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3010   -0.3316    2.9454 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2973   -0.3158    0.4610 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8324    0.9157    1.1041 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1693    1.2707    1.1859 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8291    2.4678    1.5651 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0303    2.3640   -0.7011 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2211    1.0990   -1.1185 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8856    3.9615   -0.2055 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9793    2.7167   -0.7713 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8154    2.6095   -3.0761 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0050    4.6114   -3.8667 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1487    6.0020   -2.1347 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8583    5.3889   -0.8028 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8475    6.7246   -1.8289 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4168    7.5738   -1.0973 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5533    8.1764   -3.3213 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1491    8.7712   -2.9339 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1363    6.9047   -4.4245 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4925    6.4092   -4.8135 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9277    8.5383   -5.7987 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2425    7.6417   -6.6123 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9512    9.2015   -5.9375 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6328   10.0027   -6.7650 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3003   10.2351   -3.7740 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7780   10.8767   -4.5129 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0389   12.2249   -5.9508 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5742   11.3995   -5.6273 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7514   12.3980   -4.3135 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.5042   -5.1046    2.6138 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2284   -4.7080    3.8039 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.4135   -2.3069    1.9544 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7433   -1.1498    5.8815 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.1625   -0.5709    4.9385 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1899    1.3000    6.2871 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6183    2.5540    4.1624 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9001    0.5396    6.3946 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6715    0.6164    4.6444 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3664    3.4560    3.8686 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7836    3.8449    6.9608 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 24 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
 41 42  1  0
 21 43  1  0
 43 44  1  0
 44 45  1  0
 45 46  2  0
 45 47  1  0
 45 48  1  0
 48 49  1  0
 49 50  1  0
 50 51  1  0
 50 52  1  0
 52 53  1  0
 53 54  1  0
 54 55  2  0
 54 56  1  0
 54 57  1  0
  1 58  1  0
  1 59  1  0
  1 60  1  0
  2 61  1  0
  2 62  1  0
  3 63  1  0
  3 64  1  0
  4 65  1  0
  4 66  1  0
  5 67  1  0
  5 68  1  0
  6 69  1  0
  6 70  1  0
  7 71  1  0
  8 72  1  0
  9 73  1  0
  9 74  1  0
 10 75  1  0
 10 76  1  0
 11 77  1  0
 11 78  1  0
 12 79  1  0
 12 80  1  0
 13 81  1  0
 13 82  1  0
 14 83  1  0
 14 84  1  0
 15 85  1  0
 15 86  1  0
 16 87  1  0
 16 88  1  0
 17 89  1  0
 17 90  1  0
 21 91  1  1
 22 92  1  0
 22 93  1  0
 26 94  1  0
 26 95  1  0
 27 96  1  0
 27 97  1  0
 28 98  1  0
 28 99  1  0
 29100  1  0
 29101  1  0
 30102  1  0
 30103  1  0
 31104  1  0
 31105  1  0
 32106  1  0
 32107  1  0
 33108  1  0
 34109  1  0
 35110  1  0
 35111  1  0
 36112  1  0
 36113  1  0
 37114  1  0
 37115  1  0
 38116  1  0
 38117  1  0
 39118  1  0
 39119  1  0
 40120  1  0
 40121  1  0
 41122  1  0
 41123  1  0
 42124  1  0
 42125  1  0
 42126  1  0
 43127  1  0
 43128  1  0
 47129  1  0
 49130  1  0
 49131  1  0
 50132  1  1
 51133  1  0
 52134  1  0
 52135  1  0
 56136  1  0
 57137  1  0
M  END

HEADER    PROTEIN                                 30-MAR-20   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   30-MAR-20         0                                  
HETATM    1  C   UNK     0      40.292  -5.951   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0      39.032  -6.678   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0      37.771  -5.951   0.000  0.00  0.00           C+0
HETATM    4  O   UNK     0      41.552  -6.678   0.000  0.00  0.00           O+0
HETATM    5  O   UNK     0      36.511  -6.678   0.000  0.00  0.00           O+0
HETATM    6  O   UNK     0      38.048  -8.133   0.000  0.00  0.00           O+0
HETATM    7  P   UNK     0      42.812  -5.951   0.000  0.00  0.00           P+0
HETATM    8  O   UNK     0      42.085  -4.690   0.000  0.00  0.00           O+0
HETATM    9  O   UNK     0      43.540  -7.211   0.000  0.00  0.00           O+0
HETATM   10  O   UNK     0      44.073  -5.223   0.000  0.00  0.00           O+0
HETATM   11  C   UNK     0      45.333  -5.951   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0      46.593  -5.223   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0      47.853  -5.951   0.000  0.00  0.00           C+0
HETATM   14  H   UNK     0      40.129  -8.189   0.000  0.00  0.00           H+0
HETATM   15  O   UNK     0      49.044  -5.154   0.000  0.00  0.00           O+0
HETATM   16  H   UNK     0      47.669  -3.944   0.000  0.00  0.00           H+0
HETATM   17  O   UNK     0      45.451  -3.944   0.000  0.00  0.00           O+0
HETATM   18  C   UNK     0      12.505  -5.908   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0      13.838  -6.678   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0      15.172  -5.908   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0      16.506  -6.678   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0      17.839  -5.908   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0      19.173  -6.678   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0      20.507  -5.908   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0      21.841  -6.678   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0      23.174  -5.908   0.000  0.00  0.00           C+0
HETATM   27  C   UNK     0      24.508  -5.908   0.000  0.00  0.00           C+0
HETATM   28  C   UNK     0      25.842  -6.678   0.000  0.00  0.00           C+0
HETATM   29  C   UNK     0      27.175  -5.908   0.000  0.00  0.00           C+0
HETATM   30  C   UNK     0      28.509  -6.678   0.000  0.00  0.00           C+0
HETATM   31  C   UNK     0      29.843  -5.908   0.000  0.00  0.00           C+0
HETATM   32  C   UNK     0      31.177  -6.678   0.000  0.00  0.00           C+0
HETATM   33  C   UNK     0      32.510  -5.908   0.000  0.00  0.00           C+0
HETATM   34  C   UNK     0      33.844  -6.678   0.000  0.00  0.00           C+0
HETATM   35  C   UNK     0      35.178  -5.908   0.000  0.00  0.00           C+0
HETATM   36  O   UNK     0      35.178  -4.368   0.000  0.00  0.00           O+0
HETATM   37  C   UNK     0      14.042  -8.903   0.000  0.00  0.00           C+0
HETATM   38  C   UNK     0      15.376  -8.133   0.000  0.00  0.00           C+0
HETATM   39  C   UNK     0      16.709  -8.903   0.000  0.00  0.00           C+0
HETATM   40  C   UNK     0      18.043  -8.133   0.000  0.00  0.00           C+0
HETATM   41  C   UNK     0      19.377  -8.903   0.000  0.00  0.00           C+0
HETATM   42  C   UNK     0      20.710  -8.133   0.000  0.00  0.00           C+0
HETATM   43  C   UNK     0      22.044  -8.903   0.000  0.00  0.00           C+0
HETATM   44  C   UNK     0      23.378  -8.903   0.000  0.00  0.00           C+0
HETATM   45  C   UNK     0      24.711  -8.133   0.000  0.00  0.00           C+0
HETATM   46  C   UNK     0      26.045  -8.903   0.000  0.00  0.00           C+0
HETATM   47  C   UNK     0      27.379  -8.133   0.000  0.00  0.00           C+0
HETATM   48  C   UNK     0      28.713  -8.903   0.000  0.00  0.00           C+0
HETATM   49  C   UNK     0      30.046  -8.133   0.000  0.00  0.00           C+0
HETATM   50  C   UNK     0      31.380  -8.903   0.000  0.00  0.00           C+0
HETATM   51  C   UNK     0      32.714  -8.133   0.000  0.00  0.00           C+0
HETATM   52  C   UNK     0      34.047  -8.903   0.000  0.00  0.00           C+0
HETATM   53  C   UNK     0      35.381  -8.133   0.000  0.00  0.00           C+0
HETATM   54  C   UNK     0      36.715  -8.903   0.000  0.00  0.00           C+0
HETATM   55  O   UNK     0      36.715 -10.443   0.000  0.00  0.00           O+0
HETATM   56  P   UNK     0      50.425  -5.835   0.000  0.00  0.00           P+0
HETATM   57  O   UNK     0      51.807  -6.516   0.000  0.00  0.00           O+0
HETATM   58  O   UNK     0      51.106  -4.453   0.000  0.00  0.00           O+0
HETATM   59  O   UNK     0      49.745  -7.216   0.000  0.00  0.00           O+0
HETATM   60  H   UNK     0      39.656  -4.437   0.000  0.00  0.00           H+0
HETATM   61  H   UNK     0      41.023  -4.476   0.000  0.00  0.00           H+0
HETATM   62  H   UNK     0      38.558  -4.494   0.000  0.00  0.00           H+0
HETATM   63  H   UNK     0      37.277  -4.268   0.000  0.00  0.00           H+0
HETATM   64  H   UNK     0      43.161  -8.836   0.000  0.00  0.00           H+0
HETATM   65  H   UNK     0      44.963  -7.734   0.000  0.00  0.00           H+0
HETATM   66  H   UNK     0      46.215  -7.363   0.000  0.00  0.00           H+0
HETATM   67  H   UNK     0      47.302  -7.476   0.000  0.00  0.00           H+0
HETATM   68  H   UNK     0      48.668  -7.360   0.000  0.00  0.00           H+0
HETATM   69  H   UNK     0      45.755  -2.313   0.000  0.00  0.00           H+0
HETATM   70  H   UNK     0      12.762  -4.254   0.000  0.00  0.00           H+0
HETATM   71  H   UNK     0      11.213  -4.769   0.000  0.00  0.00           H+0
HETATM   72  H   UNK     0      10.806  -6.098   0.000  0.00  0.00           H+0
HETATM   73  H   UNK     0      12.153  -8.008   0.000  0.00  0.00           H+0
HETATM   74  H   UNK     0      13.369  -8.301   0.000  0.00  0.00           H+0
HETATM   75  H   UNK     0      14.134  -4.310   0.000  0.00  0.00           H+0
HETATM   76  H   UNK     0      15.669  -4.027   0.000  0.00  0.00           H+0
HETATM   77  H   UNK     0      16.168  -8.082   0.000  0.00  0.00           H+0
HETATM   78  H   UNK     0      17.151  -8.038   0.000  0.00  0.00           H+0
HETATM   79  H   UNK     0      17.073  -4.117   0.000  0.00  0.00           H+0
HETATM   80  H   UNK     0      18.445  -4.101   0.000  0.00  0.00           H+0
HETATM   81  H   UNK     0      18.896  -8.081   0.000  0.00  0.00           H+0
HETATM   82  H   UNK     0      19.871  -7.998   0.000  0.00  0.00           H+0
HETATM   83  H   UNK     0      19.781  -4.032   0.000  0.00  0.00           H+0
HETATM   84  H   UNK     0      21.140  -4.171   0.000  0.00  0.00           H+0
HETATM   85  H   UNK     0      21.693  -8.095   0.000  0.00  0.00           H+0
HETATM   86  H   UNK     0      22.861  -7.946   0.000  0.00  0.00           H+0
HETATM   87  H   UNK     0      22.912  -4.105   0.000  0.00  0.00           H+0
HETATM   88  H   UNK     0      24.555  -4.008   0.000  0.00  0.00           H+0
HETATM   89  H   UNK     0      25.496  -8.090   0.000  0.00  0.00           H+0
HETATM   90  H   UNK     0      26.465  -8.082   0.000  0.00  0.00           H+0
HETATM   91  H   UNK     0      26.615  -4.106   0.000  0.00  0.00           H+0
HETATM   92  H   UNK     0      27.863  -4.055   0.000  0.00  0.00           H+0
HETATM   93  H   UNK     0      28.216  -8.075   0.000  0.00  0.00           H+0
HETATM   94  H   UNK     0      29.168  -8.042   0.000  0.00  0.00           H+0
HETATM   95  H   UNK     0      29.192  -4.081   0.000  0.00  0.00           H+0
HETATM   96  H   UNK     0      30.535  -4.069   0.000  0.00  0.00           H+0
HETATM   97  H   UNK     0      30.884  -8.101   0.000  0.00  0.00           H+0
HETATM   98  H   UNK     0      31.866  -8.002   0.000  0.00  0.00           H+0
HETATM   99  H   UNK     0      31.879  -4.047   0.000  0.00  0.00           H+0
HETATM  100  H   UNK     0      33.132  -4.061   0.000  0.00  0.00           H+0
HETATM  101  H   UNK     0      33.587  -8.119   0.000  0.00  0.00           H+0
HETATM  102  H   UNK     0      34.582  -8.024   0.000  0.00  0.00           H+0
HETATM  103  H   UNK     0      12.845  -7.416   0.000  0.00  0.00           H+0
HETATM  104  H   UNK     0      12.409  -9.982   0.000  0.00  0.00           H+0
HETATM  105  H   UNK     0      14.454 -10.637   0.000  0.00  0.00           H+0
HETATM  106  H   UNK     0      14.537  -7.109   0.000  0.00  0.00           H+0
HETATM  107  H   UNK     0      15.558  -6.709   0.000  0.00  0.00           H+0
HETATM  108  H   UNK     0      15.788 -10.587   0.000  0.00  0.00           H+0
HETATM  109  H   UNK     0      17.231 -10.765   0.000  0.00  0.00           H+0
HETATM  110  H   UNK     0      17.355  -6.825   0.000  0.00  0.00           H+0
HETATM  111  H   UNK     0      18.333  -6.729   0.000  0.00  0.00           H+0
HETATM  112  H   UNK     0      18.618 -10.734   0.000  0.00  0.00           H+0
HETATM  113  H   UNK     0      19.883 -10.713   0.000  0.00  0.00           H+0
HETATM  114  H   UNK     0      20.079  -6.740   0.000  0.00  0.00           H+0
HETATM  115  H   UNK     0      21.055  -6.712   0.000  0.00  0.00           H+0
HETATM  116  H   UNK     0      21.987 -10.801   0.000  0.00  0.00           H+0
HETATM  117  H   UNK     0      23.629 -10.705   0.000  0.00  0.00           H+0
HETATM  118  H   UNK     0      23.686  -6.864   0.000  0.00  0.00           H+0
HETATM  119  H   UNK     0      24.855  -6.714   0.000  0.00  0.00           H+0
HETATM  120  H   UNK     0      25.372 -10.644   0.000  0.00  0.00           H+0
HETATM  121  H   UNK     0      26.749 -10.756   0.000  0.00  0.00           H+0
HETATM  122  H   UNK     0      26.679  -6.834   0.000  0.00  0.00           H+0
HETATM  123  H   UNK     0      27.653  -6.715   0.000  0.00  0.00           H+0
HETATM  124  H   UNK     0      28.037 -10.684   0.000  0.00  0.00           H+0
HETATM  125  H   UNK     0      29.399 -10.777   0.000  0.00  0.00           H+0
HETATM  126  H   UNK     0      29.373  -6.808   0.000  0.00  0.00           H+0
HETATM  127  H   UNK     0      30.336  -6.728   0.000  0.00  0.00           H+0
HETATM  128  H   UNK     0      30.776 -10.737   0.000  0.00  0.00           H+0
HETATM  129  H   UNK     0      32.123 -10.693   0.000  0.00  0.00           H+0
HETATM  130  H   UNK     0      32.054  -6.795   0.000  0.00  0.00           H+0
HETATM  131  H   UNK     0      33.018  -6.725   0.000  0.00  0.00           H+0
HETATM  132  H   UNK     0      33.459 -10.784   0.000  0.00  0.00           H+0
HETATM  133  H   UNK     0      34.835 -10.582   0.000  0.00  0.00           H+0
HETATM  134  H   UNK     0      34.750  -6.766   0.000  0.00  0.00           H+0
HETATM  135  H   UNK     0      35.743  -6.763   0.000  0.00  0.00           H+0
HETATM  136  H   UNK     0      52.704  -4.181   0.000  0.00  0.00           H+0
HETATM  137  H   UNK     0      51.095  -8.250   0.000  0.00  0.00           H+0
CONECT    1    2    4   60   61                                             
CONECT    2    1    3    6   14                                             
CONECT    3    2    5   62   63                                             
CONECT    4    1    7                                                       
CONECT    5    3   35                                                       
CONECT    6    2   54                                                       
CONECT    7    4    8    9   10                                             
CONECT    8    7                                                            
CONECT    9    7   64                                                       
CONECT   10    7   11                                                       
CONECT   11   10   12   65   66                                             
CONECT   12   11   13   16   17                                             
CONECT   13   12   15   67   68                                             
CONECT   14    2                                                            
CONECT   15   13   56                                                       
CONECT   16   12                                                            
CONECT   17   12   69                                                       
CONECT   18   19   70   71   72                                             
CONECT   19   18   20   73   74                                             
CONECT   20   19   21   75   76                                             
CONECT   21   20   22   77   78                                             
CONECT   22   21   23   79   80                                             
CONECT   23   22   24   81   82                                             
CONECT   24   23   25   83   84                                             
CONECT   25   24   26   85   86                                             
CONECT   26   25   27   87                                                  
CONECT   27   26   28   88                                                  
CONECT   28   27   29   89   90                                             
CONECT   29   28   30   91   92                                             
CONECT   30   29   31   93   94                                             
CONECT   31   30   32   95   96                                             
CONECT   32   31   33   97   98                                             
CONECT   33   32   34   99  100                                             
CONECT   34   33   35  101  102                                             
CONECT   35   34   36    5                                                  
CONECT   36   35                                                            
CONECT   37   38  103  104  105                                             
CONECT   38   37   39  106  107                                             
CONECT   39   38   40  108  109                                             
CONECT   40   39   41  110  111                                             
CONECT   41   40   42  112  113                                             
CONECT   42   41   43  114  115                                             
CONECT   43   42   44  116                                                  
CONECT   44   43   45  117                                                  
CONECT   45   44   46  118  119                                             
CONECT   46   45   47  120  121                                             
CONECT   47   46   48  122  123                                             
CONECT   48   47   49  124  125                                             
CONECT   49   48   50  126  127                                             
CONECT   50   49   51  128  129                                             
CONECT   51   50   52  130  131                                             
CONECT   52   51   53  132  133                                             
CONECT   53   52   54  134  135                                             
CONECT   54   53   55    6                                                  
CONECT   55   54                                                            
CONECT   56   57   58   59   15                                             
CONECT   57   56                                                            
CONECT   58   56  136                                                       
CONECT   59   56  137                                                       
CONECT   60    1                                                            
CONECT   61    1                                                            
CONECT   62    3                                                            
CONECT   63    3                                                            
CONECT   64    9                                                            
CONECT   65   11                                                            
CONECT   66   11                                                            
CONECT   67   13                                                            
CONECT   68   13                                                            
CONECT   69   17                                                            
CONECT   70   18                                                            
CONECT   71   18                                                            
CONECT   72   18                                                            
CONECT   73   19                                                            
CONECT   74   19                                                            
CONECT   75   20                                                            
CONECT   76   20                                                            
CONECT   77   21                                                            
CONECT   78   21                                                            
CONECT   79   22                                                            
CONECT   80   22                                                            
CONECT   81   23                                                            
CONECT   82   23                                                            
CONECT   83   24                                                            
CONECT   84   24                                                            
CONECT   85   25                                                            
CONECT   86   25                                                            
CONECT   87   26                                                            
CONECT   88   27                                                            
CONECT   89   28                                                            
CONECT   90   28                                                            
CONECT   91   29                                                            
CONECT   92   29                                                            
CONECT   93   30                                                            
CONECT   94   30                                                            
CONECT   95   31                                                            
CONECT   96   31                                                            
CONECT   97   32                                                            
CONECT   98   32                                                            
CONECT   99   33                                                            
CONECT  100   33                                                            
CONECT  101   34                                                            
CONECT  102   34                                                            
CONECT  103   37                                                            
CONECT  104   37                                                            
CONECT  105   37                                                            
CONECT  106   38                                                            
CONECT  107   38                                                            
CONECT  108   39                                                            
CONECT  109   39                                                            
CONECT  110   40                                                            
CONECT  111   40                                                            
CONECT  112   41                                                            
CONECT  113   41                                                            
CONECT  114   42                                                            
CONECT  115   42                                                            
CONECT  116   43                                                            
CONECT  117   44                                                            
CONECT  118   45                                                            
CONECT  119   45                                                            
CONECT  120   46                                                            
CONECT  121   46                                                            
CONECT  122   47                                                            
CONECT  123   47                                                            
CONECT  124   48                                                            
CONECT  125   48                                                            
CONECT  126   49                                                            
CONECT  127   49                                                            
CONECT  128   50                                                            
CONECT  129   50                                                            
CONECT  130   51                                                            
CONECT  131   51                                                            
CONECT  132   52                                                            
CONECT  133   52                                                            
CONECT  134   53                                                            
CONECT  135   53                                                            
CONECT  136   58                                                            
CONECT  137   59                                                            
MASTER        0    0    0    0    0    0    0    0  137    0  272    0
END

COMPND    HMDB0013535
HETATM    1  C1  UNL     1      -8.835   0.726   0.657  1.00  0.00           C  
HETATM    2  C2  UNL     1      -7.368   0.716   0.333  1.00  0.00           C  
HETATM    3  C3  UNL     1      -6.994  -0.480  -0.561  1.00  0.00           C  
HETATM    4  C4  UNL     1      -5.532  -0.355  -0.804  1.00  0.00           C  
HETATM    5  C5  UNL     1      -4.901  -1.403  -1.654  1.00  0.00           C  
HETATM    6  C6  UNL     1      -5.014  -2.803  -1.097  1.00  0.00           C  
HETATM    7  C7  UNL     1      -4.408  -2.980   0.204  1.00  0.00           C  
HETATM    8  C8  UNL     1      -3.442  -3.789   0.480  1.00  0.00           C  
HETATM    9  C9  UNL     1      -2.809  -4.669  -0.520  1.00  0.00           C  
HETATM   10  C10 UNL     1      -1.380  -4.243  -0.599  1.00  0.00           C  
HETATM   11  C11 UNL     1      -0.512  -5.023  -1.551  1.00  0.00           C  
HETATM   12  C12 UNL     1       0.837  -4.345  -1.492  1.00  0.00           C  
HETATM   13  C13 UNL     1       1.884  -4.947  -2.369  1.00  0.00           C  
HETATM   14  C14 UNL     1       3.138  -4.078  -2.266  1.00  0.00           C  
HETATM   15  C15 UNL     1       4.248  -4.532  -3.122  1.00  0.00           C  
HETATM   16  C16 UNL     1       4.924  -5.815  -2.956  1.00  0.00           C  
HETATM   17  C17 UNL     1       5.726  -6.003  -1.746  1.00  0.00           C  
HETATM   18  C18 UNL     1       5.233  -6.048  -0.397  1.00  0.00           C  
HETATM   19  O1  UNL     1       5.010  -7.216   0.149  1.00  0.00           O  
HETATM   20  O2  UNL     1       4.950  -5.011   0.474  1.00  0.00           O  
HETATM   21  C19 UNL     1       4.535  -5.163   1.809  1.00  0.00           C  
HETATM   22  C20 UNL     1       3.126  -4.905   2.139  1.00  0.00           C  
HETATM   23  O3  UNL     1       2.582  -3.655   1.832  1.00  0.00           O  
HETATM   24  C21 UNL     1       1.256  -3.465   2.244  1.00  0.00           C  
HETATM   25  O4  UNL     1       0.712  -4.442   2.873  1.00  0.00           O  
HETATM   26  C22 UNL     1       0.438  -2.292   2.034  1.00  0.00           C  
HETATM   27  C23 UNL     1       0.672  -1.131   2.940  1.00  0.00           C  
HETATM   28  C24 UNL     1      -0.294   0.002   2.639  1.00  0.00           C  
HETATM   29  C25 UNL     1      -0.179   0.478   1.231  1.00  0.00           C  
HETATM   30  C26 UNL     1      -1.169   1.616   0.944  1.00  0.00           C  
HETATM   31  C27 UNL     1      -0.999   2.013  -0.505  1.00  0.00           C  
HETATM   32  C28 UNL     1      -1.943   3.151  -0.909  1.00  0.00           C  
HETATM   33  C29 UNL     1      -1.657   3.414  -2.320  1.00  0.00           C  
HETATM   34  C30 UNL     1      -1.211   4.574  -2.775  1.00  0.00           C  
HETATM   35  C31 UNL     1      -0.967   5.690  -1.880  1.00  0.00           C  
HETATM   36  C32 UNL     1      -1.717   6.924  -2.005  1.00  0.00           C  
HETATM   37  C33 UNL     1      -1.640   7.802  -3.180  1.00  0.00           C  
HETATM   38  C34 UNL     1      -2.095   7.325  -4.502  1.00  0.00           C  
HETATM   39  C35 UNL     1      -2.030   8.254  -5.652  1.00  0.00           C  
HETATM   40  C36 UNL     1      -2.848   9.462  -5.769  1.00  0.00           C  
HETATM   41  C37 UNL     1      -2.768  10.517  -4.740  1.00  0.00           C  
HETATM   42  C38 UNL     1      -3.635  11.739  -5.170  1.00  0.00           C  
HETATM   43  C39 UNL     1       5.545  -4.541   2.759  1.00  0.00           C  
HETATM   44  O5  UNL     1       5.708  -3.185   2.497  1.00  0.00           O  
HETATM   45  P1  UNL     1       6.832  -2.514   3.549  1.00  0.00           P  
HETATM   46  O6  UNL     1       6.872  -3.253   4.878  1.00  0.00           O  
HETATM   47  O7  UNL     1       8.394  -2.661   2.877  1.00  0.00           O  
HETATM   48  O8  UNL     1       6.479  -0.900   3.888  1.00  0.00           O  
HETATM   49  C40 UNL     1       7.067  -0.471   5.092  1.00  0.00           C  
HETATM   50  C41 UNL     1       6.695   0.975   5.361  1.00  0.00           C  
HETATM   51  O9  UNL     1       7.195   1.739   4.307  1.00  0.00           O  
HETATM   52  C42 UNL     1       5.194   1.120   5.481  1.00  0.00           C  
HETATM   53  O10 UNL     1       4.825   2.426   5.702  1.00  0.00           O  
HETATM   54  P2  UNL     1       3.144   2.590   5.815  1.00  0.00           P  
HETATM   55  O11 UNL     1       2.511   1.422   6.525  1.00  0.00           O  
HETATM   56  O12 UNL     1       2.565   2.553   4.204  1.00  0.00           O  
HETATM   57  O13 UNL     1       2.659   4.027   6.510  1.00  0.00           O  
HETATM   58  H1  UNL     1      -9.050   1.741   1.100  1.00  0.00           H  
HETATM   59  H2  UNL     1      -9.149  -0.017   1.393  1.00  0.00           H  
HETATM   60  H3  UNL     1      -9.438   0.694  -0.284  1.00  0.00           H  
HETATM   61  H4  UNL     1      -7.085   1.675  -0.108  1.00  0.00           H  
HETATM   62  H5  UNL     1      -6.821   0.637   1.317  1.00  0.00           H  
HETATM   63  H6  UNL     1      -7.620  -0.442  -1.454  1.00  0.00           H  
HETATM   64  H7  UNL     1      -7.196  -1.375   0.081  1.00  0.00           H  
HETATM   65  H8  UNL     1      -5.051  -0.330   0.225  1.00  0.00           H  
HETATM   66  H9  UNL     1      -5.330   0.658  -1.204  1.00  0.00           H  
HETATM   67  H10 UNL     1      -5.445  -1.419  -2.622  1.00  0.00           H  
HETATM   68  H11 UNL     1      -3.865  -1.089  -1.888  1.00  0.00           H  
HETATM   69  H12 UNL     1      -6.139  -2.988  -1.085  1.00  0.00           H  
HETATM   70  H13 UNL     1      -4.662  -3.472  -1.899  1.00  0.00           H  
HETATM   71  H14 UNL     1      -4.799  -2.372   1.040  1.00  0.00           H  
HETATM   72  H15 UNL     1      -3.032  -3.872   1.500  1.00  0.00           H  
HETATM   73  H16 UNL     1      -2.794  -5.710  -0.049  1.00  0.00           H  
HETATM   74  H17 UNL     1      -3.315  -4.810  -1.459  1.00  0.00           H  
HETATM   75  H18 UNL     1      -1.335  -3.181  -0.881  1.00  0.00           H  
HETATM   76  H19 UNL     1      -0.920  -4.352   0.414  1.00  0.00           H  
HETATM   77  H20 UNL     1      -0.931  -4.844  -2.586  1.00  0.00           H  
HETATM   78  H21 UNL     1      -0.479  -6.095  -1.372  1.00  0.00           H  
HETATM   79  H22 UNL     1       0.654  -3.270  -1.692  1.00  0.00           H  
HETATM   80  H23 UNL     1       1.184  -4.386  -0.425  1.00  0.00           H  
HETATM   81  H24 UNL     1       1.570  -5.088  -3.396  1.00  0.00           H  
HETATM   82  H25 UNL     1       2.169  -5.925  -1.923  1.00  0.00           H  
HETATM   83  H26 UNL     1       2.781  -3.089  -2.745  1.00  0.00           H  
HETATM   84  H27 UNL     1       3.382  -3.877  -1.213  1.00  0.00           H  
HETATM   85  H28 UNL     1       5.009  -3.660  -3.098  1.00  0.00           H  
HETATM   86  H29 UNL     1       3.872  -4.399  -4.206  1.00  0.00           H  
HETATM   87  H30 UNL     1       4.214  -6.699  -3.101  1.00  0.00           H  
HETATM   88  H31 UNL     1       5.625  -5.915  -3.870  1.00  0.00           H  
HETATM   89  H32 UNL     1       6.629  -5.247  -1.770  1.00  0.00           H  
HETATM   90  H33 UNL     1       6.343  -6.969  -1.895  1.00  0.00           H  
HETATM   91  H34 UNL     1       4.645  -6.306   2.009  1.00  0.00           H  
HETATM   92  H35 UNL     1       2.514  -5.723   1.671  1.00  0.00           H  
HETATM   93  H36 UNL     1       3.020  -5.072   3.258  1.00  0.00           H  
HETATM   94  H37 UNL     1       0.591  -1.995   0.943  1.00  0.00           H  
HETATM   95  H38 UNL     1      -0.655  -2.604   2.041  1.00  0.00           H  
HETATM   96  H39 UNL     1       1.714  -0.809   2.887  1.00  0.00           H  
HETATM   97  H40 UNL     1       0.491  -1.449   3.983  1.00  0.00           H  
HETATM   98  H41 UNL     1       0.009   0.834   3.305  1.00  0.00           H  
HETATM   99  H42 UNL     1      -1.301  -0.332   2.945  1.00  0.00           H  
HETATM  100  H43 UNL     1      -0.297  -0.316   0.461  1.00  0.00           H  
HETATM  101  H44 UNL     1       0.832   0.916   1.104  1.00  0.00           H  
HETATM  102  H45 UNL     1      -2.169   1.271   1.186  1.00  0.00           H  
HETATM  103  H46 UNL     1      -0.829   2.468   1.565  1.00  0.00           H  
HETATM  104  H47 UNL     1       0.030   2.364  -0.701  1.00  0.00           H  
HETATM  105  H48 UNL     1      -1.221   1.099  -1.118  1.00  0.00           H  
HETATM  106  H49 UNL     1      -1.886   3.962  -0.205  1.00  0.00           H  
HETATM  107  H50 UNL     1      -2.979   2.717  -0.771  1.00  0.00           H  
HETATM  108  H51 UNL     1      -1.815   2.609  -3.076  1.00  0.00           H  
HETATM  109  H52 UNL     1      -1.005   4.611  -3.867  1.00  0.00           H  
HETATM  110  H53 UNL     1       0.149   6.002  -2.135  1.00  0.00           H  
HETATM  111  H54 UNL     1      -0.858   5.389  -0.803  1.00  0.00           H  
HETATM  112  H55 UNL     1      -2.848   6.725  -1.829  1.00  0.00           H  
HETATM  113  H56 UNL     1      -1.417   7.574  -1.097  1.00  0.00           H  
HETATM  114  H57 UNL     1      -0.553   8.176  -3.321  1.00  0.00           H  
HETATM  115  H58 UNL     1      -2.149   8.771  -2.934  1.00  0.00           H  
HETATM  116  H59 UNL     1      -3.136   6.905  -4.424  1.00  0.00           H  
HETATM  117  H60 UNL     1      -1.492   6.409  -4.813  1.00  0.00           H  
HETATM  118  H61 UNL     1      -0.928   8.538  -5.799  1.00  0.00           H  
HETATM  119  H62 UNL     1      -2.243   7.642  -6.612  1.00  0.00           H  
HETATM  120  H63 UNL     1      -3.951   9.201  -5.938  1.00  0.00           H  
HETATM  121  H64 UNL     1      -2.633  10.003  -6.765  1.00  0.00           H  
HETATM  122  H65 UNL     1      -3.300  10.235  -3.774  1.00  0.00           H  
HETATM  123  H66 UNL     1      -1.778  10.877  -4.513  1.00  0.00           H  
HETATM  124  H67 UNL     1      -3.039  12.225  -5.951  1.00  0.00           H  
HETATM  125  H68 UNL     1      -4.574  11.400  -5.627  1.00  0.00           H  
HETATM  126  H69 UNL     1      -3.751  12.398  -4.313  1.00  0.00           H  
HETATM  127  H70 UNL     1       6.504  -5.105   2.614  1.00  0.00           H  
HETATM  128  H71 UNL     1       5.228  -4.708   3.804  1.00  0.00           H  
HETATM  129  H72 UNL     1       8.413  -2.307   1.954  1.00  0.00           H  
HETATM  130  H73 UNL     1       6.743  -1.150   5.882  1.00  0.00           H  
HETATM  131  H74 UNL     1       8.163  -0.571   4.939  1.00  0.00           H  
HETATM  132  H75 UNL     1       7.190   1.300   6.287  1.00  0.00           H  
HETATM  133  H76 UNL     1       6.618   2.554   4.162  1.00  0.00           H  
HETATM  134  H77 UNL     1       4.900   0.540   6.395  1.00  0.00           H  
HETATM  135  H78 UNL     1       4.672   0.616   4.644  1.00  0.00           H  
HETATM  136  H79 UNL     1       2.366   3.456   3.869  1.00  0.00           H  
HETATM  137  H80 UNL     1       1.784   3.845   6.961  1.00  0.00           H  
CONECT    1    2   58   59   60
CONECT    2    3   61   62
CONECT    3    4   63   64
CONECT    4    5   65   66
CONECT    5    6   67   68
CONECT    6    7   69   70
CONECT    7    8    8   71
CONECT    8    9   72
CONECT    9   10   73   74
CONECT   10   11   75   76
CONECT   11   12   77   78
CONECT   12   13   79   80
CONECT   13   14   81   82
CONECT   14   15   83   84
CONECT   15   16   85   86
CONECT   16   17   87   88
CONECT   17   18   89   90
CONECT   18   19   19   20
CONECT   20   21
CONECT   21   22   43   91
CONECT   22   23   92   93
CONECT   23   24
CONECT   24   25   25   26
CONECT   26   27   94   95
CONECT   27   28   96   97
CONECT   28   29   98   99
CONECT   29   30  100  101
CONECT   30   31  102  103
CONECT   31   32  104  105
CONECT   32   33  106  107
CONECT   33   34   34  108
CONECT   34   35  109
CONECT   35   36  110  111
CONECT   36   37  112  113
CONECT   37   38  114  115
CONECT   38   39  116  117
CONECT   39   40  118  119
CONECT   40   41  120  121
CONECT   41   42  122  123
CONECT   42  124  125  126
CONECT   43   44  127  128
CONECT   44   45
CONECT   45   46   46   47   48
CONECT   47  129
CONECT   48   49
CONECT   49   50  130  131
CONECT   50   51   52  132
CONECT   51  133
CONECT   52   53  134  135
CONECT   53   54
CONECT   54   55   55   56   57
CONECT   56  136
CONECT   57  137
END

HMDB0013535
     RDKit          3D
PGP(18:1(9Z)/18:1(11Z))
137136  0  0  0  0  0  0  0  0999 V2000
   -8.8350    0.7256    0.6568 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3685    0.7155    0.3330 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9936   -0.4801   -0.5612 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5319   -0.3547   -0.8037 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9010   -1.4027   -1.6539 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0137   -2.8035   -1.0973 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4079   -2.9798    0.2035 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4419   -3.7886    0.4799 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8089   -4.6690   -0.5198 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3804   -4.2432   -0.5990 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5125   -5.0232   -1.5507 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8374   -4.3445   -1.4921 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8835   -4.9471   -2.3693 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1376   -4.0780   -2.2656 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2484   -4.5318   -3.1217 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9240   -5.8147   -2.9558 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7261   -6.0028   -1.7457 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2331   -6.0483   -0.3974 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0098   -7.2163    0.1486 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9500   -5.0112    0.4742 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5349   -5.1629    1.8094 C   0  0  2  0  0  0  0  0  0  0  0  0
    3.1259   -4.9047    2.1386 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5816   -3.6554    1.8316 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2564   -3.4649    2.2438 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7124   -4.4418    2.8732 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4375   -2.2917    2.0341 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6724   -1.1314    2.9405 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2943    0.0024    2.6389 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1795    0.4776    1.2315 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1687    1.6157    0.9436 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9988    2.0126   -0.5046 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9428    3.1513   -0.9089 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6569    3.4136   -2.3204 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2107    4.5736   -2.7746 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9666    5.6904   -1.8802 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7174    6.9245   -2.0046 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6403    7.8017   -3.1804 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0949    7.3248   -4.5020 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0301    8.2542   -5.6516 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8482    9.4615   -5.7692 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7680   10.5169   -4.7403 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6350   11.7386   -5.1699 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5449   -4.5413    2.7590 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7076   -3.1849    2.4971 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8323   -2.5135    3.5492 P   0  0  0  0  0  5  0  0  0  0  0  0
    6.8719   -3.2533    4.8783 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3939   -2.6608    2.8774 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4792   -0.8996    3.8880 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0674   -0.4709    5.0917 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6949    0.9753    5.3614 C   0  0  1  0  0  0  0  0  0  0  0  0
    7.1952    1.7389    4.3067 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1943    1.1201    5.4812 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8252    2.4256    5.7020 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1439    2.5898    5.8146 P   0  0  0  0  0  5  0  0  0  0  0  0
    2.5107    1.4220    6.5250 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5651    2.5532    4.2042 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6586    4.0267    6.5104 O   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0504    1.7412    1.1001 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1490   -0.0170    1.3931 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.4375    0.6944   -0.2839 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0849    1.6748   -0.1076 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8209    0.6371    1.3168 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6196   -0.4419   -1.4536 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1957   -1.3755    0.0811 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0514   -0.3302    0.2248 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3299    0.6580   -1.2038 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4447   -1.4191   -2.6221 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8651   -1.0895   -1.8884 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1391   -2.9875   -1.0852 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6619   -3.4720   -1.8992 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7993   -2.3725    1.0396 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0317   -3.8717    1.4997 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7939   -5.7105   -0.0486 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3148   -4.8098   -1.4585 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3353   -3.1813   -0.8806 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9203   -4.3518    0.4142 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9307   -4.8440   -2.5857 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4791   -6.0952   -1.3720 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.6539   -3.2696   -1.6918 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1844   -4.3865   -0.4252 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5701   -5.0885   -3.3962 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1691   -5.9250   -1.9231 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7811   -3.0893   -2.7450 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3821   -3.8766   -1.2133 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0088   -3.6603   -3.0982 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8724   -4.3988   -4.2056 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2140   -6.6991   -3.1005 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6252   -5.9154   -3.8696 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6291   -5.2467   -1.7695 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3431   -6.9692   -1.8952 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6449   -6.3063    2.0089 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5141   -5.7227    1.6714 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0204   -5.0723    3.2578 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5906   -1.9948    0.9430 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6547   -2.6041    2.0410 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7136   -0.8093    2.8871 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4908   -1.4488    3.9834 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0090    0.8335    3.3051 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3010   -0.3316    2.9454 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2973   -0.3158    0.4610 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8324    0.9157    1.1041 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1693    1.2707    1.1859 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8291    2.4678    1.5651 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0303    2.3640   -0.7011 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2211    1.0990   -1.1185 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8856    3.9615   -0.2055 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9793    2.7167   -0.7713 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8154    2.6095   -3.0761 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0050    4.6114   -3.8667 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1487    6.0020   -2.1347 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8583    5.3889   -0.8028 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8475    6.7246   -1.8289 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4168    7.5738   -1.0973 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5533    8.1764   -3.3213 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1491    8.7712   -2.9339 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1363    6.9047   -4.4245 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4925    6.4092   -4.8135 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9277    8.5383   -5.7987 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2425    7.6417   -6.6123 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9512    9.2015   -5.9375 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6328   10.0027   -6.7650 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3003   10.2351   -3.7740 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7780   10.8767   -4.5129 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0389   12.2249   -5.9508 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5742   11.3995   -5.6273 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7514   12.3980   -4.3135 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.5042   -5.1046    2.6138 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2284   -4.7080    3.8039 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.4135   -2.3069    1.9544 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7433   -1.1498    5.8815 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.1625   -0.5709    4.9385 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1899    1.3000    6.2871 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6183    2.5540    4.1624 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9001    0.5396    6.3946 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6715    0.6164    4.6444 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3664    3.4560    3.8686 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7836    3.8449    6.9608 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 24 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
 41 42  1  0
 21 43  1  0
 43 44  1  0
 44 45  1  0
 45 46  2  0
 45 47  1  0
 45 48  1  0
 48 49  1  0
 49 50  1  0
 50 51  1  0
 50 52  1  0
 52 53  1  0
 53 54  1  0
 54 55  2  0
 54 56  1  0
 54 57  1  0
  1 58  1  0
  1 59  1  0
  1 60  1  0
  2 61  1  0
  2 62  1  0
  3 63  1  0
  3 64  1  0
  4 65  1  0
  4 66  1  0
  5 67  1  0
  5 68  1  0
  6 69  1  0
  6 70  1  0
  7 71  1  0
  8 72  1  0
  9 73  1  0
  9 74  1  0
 10 75  1  0
 10 76  1  0
 11 77  1  0
 11 78  1  0
 12 79  1  0
 12 80  1  0
 13 81  1  0
 13 82  1  0
 14 83  1  0
 14 84  1  0
 15 85  1  0
 15 86  1  0
 16 87  1  0
 16 88  1  0
 17 89  1  0
 17 90  1  0
 21 91  1  1
 22 92  1  0
 22 93  1  0
 26 94  1  0
 26 95  1  0
 27 96  1  0
 27 97  1  0
 28 98  1  0
 28 99  1  0
 29100  1  0
 29101  1  0
 30102  1  0
 30103  1  0
 31104  1  0
 31105  1  0
 32106  1  0
 32107  1  0
 33108  1  0
 34109  1  0
 35110  1  0
 35111  1  0
 36112  1  0
 36113  1  0
 37114  1  0
 37115  1  0
 38116  1  0
 38117  1  0
 39118  1  0
 39119  1  0
 40120  1  0
 40121  1  0
 41122  1  0
 41123  1  0
 42124  1  0
 42125  1  0
 42126  1  0
 43127  1  0
 43128  1  0
 47129  1  0
 49130  1  0
 49131  1  0
 50132  1  1
 51133  1  0
 52134  1  0
 52135  1  0
 56136  1  0
 57137  1  0
M  END

Synonyms

Value	Source
PGP(18:1/18:1)	Lipid Annotator, HMDB
3-sn-phosphatidyl-1'-sn-glycerol 3'-phosphoric acid	Lipid Annotator, HMDB
1-oleoyl-2-vaccenoyl-sn-glycero-3-phospho-(1'-sn-glycerol-3'-phosphate)	Lipid Annotator, HMDB
PGP(18:1(9Z)/18:1(11Z))	Lipid Annotator
1-(9Z-octadecenoyl)-2-(11Z-octadecenoyl)-sn-glycero-3-phospho-(1'-sn-glycerol-3'-phosphate)	Lipid Annotator, HMDB
PGP(36:2)	Lipid Annotator, HMDB
PGP(18:1n9/18:1n7)	HMDB
PGP(18:1W9/18:1W7)	HMDB

Molecular Formula

C₄₂H₈₀O₁₃P₂

Average Mass

855.0243

Monoisotopic Mass

854.50741567

IUPAC Name

[(2S)-2-hydroxy-3-({hydroxy[(2R)-2-[(11Z)-octadec-11-enoyloxy]-3-[(9Z)-octadec-9-enoyloxy]propoxy]phosphoryl}oxy)propoxy]phosphonic acid

Traditional Name

(2S)-2-hydroxy-3-{[hydroxy((2R)-2-[(11Z)-octadec-11-enoyloxy]-3-[(9Z)-octadec-9-enoyloxy]propoxy)phosphoryl]oxy}propoxyphosphonic acid

CAS Registry Number

Not Available

SMILES

[H]O[C@@]([H])(C([H])([H])OP(=O)(O[H])O[H])C([H])([H])OP(=O)(O[H])OC([H])([H])[C@]([H])(OC(=O)C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C(\[H])=C(\[H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H])C([H])([H])OC(=O)C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C(\[H])=C(\[H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H]

InChI Identifier

InChI=1S/C42H80O13P2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-41(44)51-37-40(38-54-57(49,50)53-36-39(43)35-52-56(46,47)48)55-42(45)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h14,16-17,19,39-40,43H,3-13,15,18,20-38H2,1-2H3,(H,49,50)(H2,46,47,48)/b16-14-,19-17-/t39-,40+/m0/s1

InChI Key

HGTCUZQDUITQOP-MYVKIHSOSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as phosphatidylglycerophosphates. These are glycerophosphoglycerophosphates in which two fatty acids are bonded to the 1-glycerol moiety through ester linkages.

Kingdom

Organic compounds

Super Class

Lipids and lipid-like molecules

Class

Glycerophospholipids

Sub Class

Glycerophosphoglycerophosphates

Direct Parent

Phosphatidylglycerophosphates

Alternative Parents

Substituents

Diacylglycerophosphoglycerophosphate
Sn-glycerol-3-phosphate
Fatty acid ester
Monoalkyl phosphate
Dialkyl phosphate
Dicarboxylic acid or derivatives
Organic phosphoric acid derivative
Phosphoric acid ester
Alkyl phosphate
Fatty acyl
Secondary alcohol
Carboxylic acid ester
Carboxylic acid derivative
Organooxygen compound
Organic oxide
Organic oxygen compound
Alcohol
Carbonyl group
Hydrocarbon derivative
Aliphatic acyclic compound

Molecular Framework

Aliphatic acyclic compounds

External Descriptors

Not Available

Functional Ontology

Not Available

Physical Properties

State

Solid

Predicted Properties

Property	Value	Source
Water Solubility	0.0006 g/L	ALOGPS
logP	7.47	ALOGPS
logP	11.87	ChemAxon
logS	-6.2	ALOGPS
pKa (Strongest Acidic)	1.35	ChemAxon
pKa (Strongest Basic)	-3.4	ChemAxon
Physiological Charge	-3	ChemAxon
Hydrogen Acceptor Count	8	ChemAxon
Hydrogen Donor Count	4	ChemAxon
Polar Surface Area	195.35 Å²	ChemAxon
Rotatable Bond Count	44	ChemAxon
Refractivity	226.82 m³·mol⁻¹	ChemAxon
Polarizability	96.04 Å³	ChemAxon
Number of Rings	0	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	No	ChemAxon

Spectra

Spectrum Type	Description	Splash Key	Deposition Date	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 10V, Positive	splash10-0ab9-1482293480-899d129f2635d7bb9625	2017-09-01	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 20V, Positive	splash10-0610-4594155220-b9092100dea9a1b5a16b	2017-09-01	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 40V, Positive	splash10-0a4i-9456233300-f7943e2a9d1de25cf681	2017-09-01	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 10V, Negative	splash10-0gz9-4090030020-23494821877990ec9013	2017-09-01	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 20V, Negative	splash10-004i-9050000000-cd1bd71964b8f9b39166	2017-09-01	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 40V, Negative	splash10-004i-9000000000-538169581d8058fd4fa7	2017-09-01	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 10V, Positive	splash10-0pb9-2000009670-e4cb9491f4b4d79d46da	2021-09-22	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 20V, Positive	splash10-0a4i-2300009700-1414cf548e3f23609ad6	2021-09-22	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 40V, Positive	splash10-004r-1101910000-335cc066999b0c0c171e	2021-09-22	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 10V, Negative	splash10-0udi-0000000090-b9e1fedd74099aa14555	2021-09-23	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 20V, Negative	splash10-0ufs-9070032060-e0beb0c501798e4073d8	2021-09-23	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 40V, Negative	splash10-0fai-6090000000-a2fd8ee04f6e706c11a3	2021-09-23	View Spectrum

Chromatographic Retention Times and Retention Indices

Retention Times

Chromatography Type	Technique	Column	Deposition Date	Retention Time (s)
Liquid Chromatography	HILIC	Waters Acquity UPLC-BEH Amide column (void)	2025-10-24	348.0
Liquid Chromatography	HILIC	Accucore 150 Amide HILIC (eluted)	2025-10-24	106.8
Liquid Chromatography	Reversed-phase	Hypersil Gold 1.9 µm C18 (eluted)	2025-10-24	1129.9
Liquid Chromatography	Reversed-phase	Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) (eluted)	2025-10-24	1131.1
Liquid Chromatography	Reversed-phase	XBridge C18 3.5u 2.1x50 mm (eluted)	2025-10-24	1483.3
Liquid Chromatography	Reversed-phase	Ascentis Express C18 (eluted)	2025-10-24	192.7
Liquid Chromatography	Reversed-phase	Waters ACQUITY UPLC HSS T3 C18 (eluted)	2025-10-24	5008.5
Liquid Chromatography	HILIC	Merck SeQuant ZIC-HILIC (eluted)	2025-10-24	563.8
Liquid Chromatography	HILIC	Merck SeQuant ZIC-pHILIC (eluted)	2025-10-24	275.1
Liquid Chromatography	Reversed-phase	Waters ACQUITY UPLC HSS T3 C18 (eluted)	2025-10-24	939.6
Liquid Chromatography	HILIC	Merck SeQuant ZIC-HILIC (eluted)	2025-10-24	423.2
Liquid Chromatography	Reversed-phase	Waters ACQUITY UPLC HSS T3 C18 (eluted)	2025-10-24	187.5
Liquid Chromatography	Reversed-phase	Waters ACQUITY UPLC BEH C18 (eluted)	2025-10-24	323.1
Liquid Chromatography	HILIC	Merck SeQuant ZIC-pHILIC column (eluted)	2025-10-24	9.2
Liquid Chromatography	HILIC	Merck SeQuant ZIC-pHILIC column (void)	2025-10-24	271.6
Liquid Chromatography	Reversed-phase	Waters ACQUITY UPLC BEH C18 (eluted)	2025-10-24	1001.7
Liquid Chromatography	Reversed-phase	Waters ACQUITY UPLC BEH C18 (eluted)	2025-10-24	659.9
Liquid Chromatography	Reversed-phase	Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex (eluted)	2025-10-24	2302.5
Liquid Chromatography	Reversed-phase	Waters Atlantis T3 (2.1 x 150 mm, 5 um) (eluted)	2025-10-24	2756.3

Retention Indices

Not Available

Biological Properties

Cellular Locations

Extracellular
Membrane

Biospecimen Locations

All Tissues

Tissue Locations

All Tissues

Associated OMIM IDs

114500 (Colorectal cancer)
610247 (Eosinophilic esophagitis)

Human Proteins and Enzymes

Protein ID	Protein Name	Protein Type	Uniprot ID	Species

Human Pathways

Pathways

Name	SMPDB/PathBank

Microbial Pathways

Pathways

Name	SMPDB/PathBank	Species
Phospholipid Biosynthesis CL(18:1(9Z)/18:1(11Z)/18:1(9Z)/18:1(11Z))		Escherichia coli Pseudomonas aeruginosa Escherichia coli SMS-3-5 Escherichia coli UTI89 Escherichia coli 55989 Escherichia coli SE11 Mycobacterium marinum M Pseudomonas aeruginosa PA7 Acinetobacter sp. ADP1 Actinobacillus succinogenes 130Z Escherichia coli CFT073 Myxococcus xanthus DK 1622 Ochrobactrum anthropi Bacillus subtilis Pseudomonas stutzeri Mycobacterium tuberculosis Klebsiella pneumoniae Bacillus cereus Pseudomonas fluorescens Pf-5 Streptomyces griseus subsp. griseus NBRC 13350 Mycobacterium tuberculosis CDC1551 Bacillus amyloliquefaciens Streptococcus pneumoniae Roseburia intestinalis L1-82 Clostridium saccharoperbutylacetonicum N1-4(HMT) Salmonella enterica Clostridium acetobutylicum ATCC 824 Helicobacter pylori Staphylococcus aureus Haemophilus influenzae Haemophilus influenzae Rd KW20 Clostridium perfringens Clostridium sporogenes Rhodospirillum rubrum ATCC 11170 Lactobacillus fermentum IFO 3956 Streptococcus pneumoniae TIGR4 Aromatoleum aromaticum EbN1 Saccharopolyspora erythraea NRRL 2338 Streptomyces avermitilis MA-4680 Shewanella denitrificans OS217 Acinetobacter baumannii Akkermansia muciniphila ATCC BAA-835 Anaerococcus prevotii DSM 20548 Anaerostipes caccae Anaerostipes hadrus Arcobacter butzleri RM4018 Bacillus cereus AH187 (F4810/72) Bacillus halodurans C-125 Alkalihalobacillus pseudofirmus OF4 Bacillus timonensis 10403023 Bacteroides caccae Bacteroides cellulosilyticus Bacteroides eggerthii Bacteroides fragilis Bacteroides fragilis 638R Bacteroides fragilis YCH46 Bacteroides ovatus Bacteroides stercoris Bacteroides stercoris ATCC 43183 Bacteroides thetaiotaomicron Bacteroides thetaiotaomicron VPI-5482 Bacteroides xylanisolvens XB1A Blautia hansenii DSM 20583 Blautia obeum A2-162 Blautia obeum ATCC 29174 Brevibacillus brevis NBRC 100599 Campylobacter fetus subsp. fetus 82-40 Campylobacter hominis ATCC BAA-381 Clostridium beijerinckii NCIMB 8052 Clostridium botulinum Clostridium perfringens ATCC 13124 Clostridium saccharolyticum Clostridium sticklandii Dorea formicigenerans ATCC 27755 Dysgonomonas gadei ATCC BAA-286 Eubacterium eligens ATCC 27750 Eubacterium rectale ATCC 33656 Fusobacterium nucleatum subsp. nucleatum ATCC 25586 Geobacter metallireducens Haemophilus parainfluenzae T3T1 Limosilactobacillus fermentum Lactobacillus reuteri Methylobacterium nodulans Ochrobactrum anthropi ATCC 49188 Ochrobactrum intermedium LMG 3301 Prevotella intermedia Roseburia hominis A2-183 Ruminococcus bicirculans Ruminococcus champanellensis 18P13 = JCM 17042 Ruminococcus torques L2-14 Streptococcus salivarius lactobacillus crispatus lactobacillus vaginalis Pelobacter carbinolicus Spirochaeta thermophila Campylobacter concisus Campylobacter curvus Campylobacter lari Campylobacter rectus Campylobacter showae Comamonas testosteroni Burkholderia cepacia Pseudomonas fluorescens Pseudomonas mendocina Pseudomonas putida Pseudomonas syringae Xanthomonas campestris Bradyrhizobium japonicum Mesorhizobium loti Sinorhizobium meliloti Methylococcus capsulatus Moraxella catarrhalis Neisseria flavescens Neisseria gonorrhoeae Neisseria mucosa Acidiphilium cryptum Chromobacterium violaceum Citrobacter koseri Proteus mirabilis Shigella boydii Shigella dysenteriae Shigella flexneri Shigella sonnei Aeromonas hydrophila Vibrio vulnificus Bacteroides uniformis Campylobacter gracilis Fusobacterium gonidiaformans Fusobacterium periodonticum Fusobacterium ulcerans Desulfovibrio salexigens Desulfovibrio piger Acidithiobacillus ferrooxidans Chlorobium phaeobacteroides Ruminococcus albus Streptococcus gordonii Streptococcus oralis Streptococcus sanguinis Bacillus licheniformis Priestia megaterium Bacillus mycoides Bacillus thuringiensis Clostridium butyricum Moorella thermoacetica Clostridium kluyveri Clostridium novyi Weissella confusa Lactobacillus delbrueckii Lactobacillus helveticus Lactobacillus gasseri Lactobacillus sakei Lactobacillus coryniformis Listeria monocytogenes Actinomyces viscosus Mycobacterium avium Mycoplasma capricolum Mycoplasma gallisepticum Mycoplasma pulmonis Mycoplasma arthritidis Mycoplasma mobile Desulfobacterium autotrophicum Thermotoga neapolitana Xylella fastidiosa Roseobacter denitrificans Acidothermus cellulolyticus Campylobacter upsaliensis Neisseria subflava Staphylococcus saprophyticus Pelobacter propionicus Lactobacillus johnsonii Eubacterium brachy Helicobacter pullorum Thiobacillus denitrificans Helicobacter bilis Enterococcus casseliflavus Eubacterium eligens Eubacterium ramulus Eubacterium ventriosum Sulfurimonas denitrificans Stenotrophomonas maltophilia Leptotrichia buccalis Actinosynnema mirum Streptococcus cristatus Blautia hydrogenotrophica Desulfotomaculum reducens Burkholderia vietnamiensis Sodalis glossinidius Enterobacter cancerogenus Streptococcus constellatus Bacillus clausii Bacillus pseudofirmus Clostridium methylpentosum Bacillus selenitireducens Achromobacter xylosoxidans Burkholderia multivorans Dorea longicatena Peptacetobacter hiranonis Burkholderia cenocepacia Methylibium petroleiphilum Pelotomaculum thermopropionicum Syntrophobacter fumaroxidans Citrobacter youngae Ureaplasma parvum Collinsella stercoris Burkholderia ambifaria Prevotella copri Ilyobacter polytropus Marvinbryantia formatexigens Alicycliphilus denitrificans Desulfovibrio magneticus Shewanella denitrificans Methylocella silvestris Escherichia albertii Geobacter bemidjiensis Lactobacillus antri Lactobacillus ultunensis Streptococcus pseudopneumoniae Bacteroides nordii Phocaeicola coprocola Bacteroides pyogenes Geobacter lovleyi Syntrophus aciditrophicus Bacteroides intestinalis Bacteroides salanitronis Coprococcus comes Actinomyces oris Bacteroides fluxus Bacteroides oleiciplenus Bacteroides faecis Agrobacterium tumefaciens Alistipes shahii Bacteroides helcogenes Bacteroides xylanisolvens Blautia hansenii Blautia obeum Campylobacter coli Campylobacter hominis Campylobacter jejuni Clostridium beijerinckii Dorea formicigenerans Dysgonomonas gadei Fusobacterium nucleatum Gemella sanguinis Haemophilus parainfluenzae Klebsiella variicola Lactobacillus ruminis Leuconostoc citreum Streptococcus mitis Streptococcus parasanguinis Gemella haemolysans Rothia mucilaginosa Actinomyces graevenitzii Achromobacter xylosoxidans A8 Acinetobacter baumannii SDF Acinetobacter baumannii ACICU Acinetobacter baumannii AB0057 Acinetobacter baumannii AB307-0294 Actinobacillus pleuropneumoniae serovar 5b str. L20 Actinobacillus pleuropneumoniae serovar 3 str. JL03 Actinobacillus pleuropneumoniae serovar 7 str. AP76 Aeromonas hydrophila subsp. hydrophila ATCC 7966 Bacillus cereus ATCC 10987 Bacillus megaterium QM B1551 Bacillus thuringiensis serovar konkukian str. 97-27 Bacillus licheniformis ATCC 14580 Bacillus clausii KSM-K16 Bacillus amyloliquefaciens FZB42 Bacillus cereus B4264 Bacillus cereus AH820 Bacillus cereus G9842 Bacillus cereus Q1 Priestia megaterium DSM 319 Bacillus subtilis subsp. spizizenii str. W23 Bacillus amyloliquefaciens DSM 7 Bartonella quintana str. Toulouse Bradyrhizobium japonicum USDA 110 Campylobacter jejuni subsp. jejuni 81-176 Campylobacter jejuni subsp. doylei 269.97 Campylobacter curvus 525.92 Campylobacter concisus 13826 Campylobacter lari RM2100 Chlamydia trachomatis D/UW-3/CX Chlamydia trachomatis A/HAR-13 Chlamydia trachomatis L2b/UCH-1/proctitis Citrobacter koseri ATCC BAA-895 Clostridium perfringens str. 13 Clostridium botulinum A str. Hall Clostridium botulinum B1 str. Okra Clostridium botulinum A2 str. Kyoto Clostridium botulinum Ba4 str. 657 Clostridium sticklandii DSM 519 Clostridium sp. SY8519 Clostridium perfringens SM101 Corynebacterium aurimucosum ATCC 700975 Cronobacter sakazakii ATCC BAA-894 Delftia acidovorans SPH-1 Enterobacter cloacae subsp. cloacae ATCC 13047 Escherichia coli APEC O1 Escherichia coli E24377A Escherichia coli O127:H6 str. E2348/69 Escherichia coli UMN026 Escherichia fergusonii ATCC 35469 Escherichia coli ED1a Escherichia coli IAI39 Finegoldia magna ATCC 29328 Haemophilus influenzae 86-028NP Haemophilus influenzae PittGG Helicobacter pylori J99 Helicobacter pylori G27 Helicobacter pylori P12 Klebsiella pneumoniae subsp. pneumoniae MGH 78578 Kocuria rhizophila DC2201 Kytococcus sedentarius DSM 20547 Lactobacillus johnsonii NCC 533 Lactobacillus brevis ATCC 367 Lactobacillus reuteri DSM 20016 Lactobacillus reuteri SD2112 Laribacter hongkongensis HLHK9 Leptotrichia buccalis C-1013-b Lysinibacillus sphaericus C3-41 Mesorhizobium loti MAFF303099 Methylobacterium radiotolerans JCM 2831 Methylobacterium populi BJ001 Mobiluncus curtisii ATCC 43063 Mycobacterium avium subsp. paratuberculosis K-10 Mycobacterium avium 104 Neisseria gonorrhoeae FA 1090 Neisseria meningitidis MC58 Neisseria meningitidis Z2491 Neisseria meningitidis FAM18 Neisseria gonorrhoeae NCCP11945 Tropheryma whipplei str. Twist Escherichia coli 042 Acinetobacter calcoaceticus PHEA-2 Edwardsiella tarda FL6-60 Filifactor alocis ATCC 35896 Pediococcus pentosaceus ATCC 25745 Propionibacterium freudenreichii subsp. shermanii CIRM-BIA1 Proteus mirabilis HI4320 Pseudomonas putida KT2440 Pseudomonas fluorescens Pf0-1 Pseudomonas stutzeri A1501 Pseudomonas fluorescens SBW25 Pseudomonas putida GB-1 Rhizobium leguminosarum bv. viciae 3841 Rhizobium leguminosarum bv. trifolii WSM2304 Rhodococcus erythropolis PR4 Rothia mucilaginosa DY-18 Rothia dentocariosa ATCC 17931 Ruminococcus albus 7 Salmonella enterica subsp. enterica serovar Typhimurium str. LT2 Salmonella enterica subsp. enterica serovar Newport str. SL254 Salmonella enterica subsp. enterica serovar Heidelberg str. SL476 Salmonella enterica subsp. enterica serovar Agona str. SL483 Salmonella enterica subsp. enterica serovar Dublin str. CT02021853 Shigella sonnei Ss046 Shigella dysenteriae Sd197 Shigella flexneri 5 str. 8401 Spirosoma linguale DSM 74 Staphylococcus aureus subsp. aureus Mu50 Staphylococcus aureus subsp. aureus COL Staphylococcus aureus subsp. aureus MRSA252 Staphylococcus saprophyticus subsp. saprophyticus ATCC 15305 Staphylococcus aureus subsp. aureus NCTC 8325 Stenotrophomonas maltophilia K279a Stenotrophomonas maltophilia R551-3 Streptococcus pneumoniae D39 Streptococcus sanguinis SK36 Streptococcus gordonii str. Challis substr. CH1 Streptococcus pneumoniae Hungary19A-6 Streptococcus pneumoniae JJA Vibrio parahaemolyticus RIMD 2210633 Wolinella succinogenes DSM 1740 Yersinia enterocolitica subsp. enterocolitica 8081 Yersinia pseudotuberculosis IP 31758 Aquifex aeolicus Bacteroides cellulosilyticus DSM 14838 Bacteroides eggerthii 1_2_48FAA Bacteroides fluxus YIT 12057 Bacteroides graminisolvens Bacteroides graminisolvens DSM 19988 = JCM 15093 Bacteroides intestinalis DSM 17393 Bacteroides nordii CL02T12C05 Bacteroides oleiciplenus YIT 12058 Bacteroides ovatus ATCC 8483 Bacteroides pyogenes DSM 20611 = JCM 6294 Bacteroides uniformis ATCC 8492 Bacteroides xylanisolvens SD CC 1b Bacteroides sp. 1_1_14 Bacteroides sp. 1_1_30 Bacteroides sp. 2_1_22 Bacteroides sp. 2_2_4 Bacteroides sp. D2 Bacteroides sp. D20 Bacteroides sp. D22 Paraprevotella clara YIT 11840 Paraprevotella xylaniphila YIT 11841 Prevotella buccae ATCC 33574 Prevotella denticola Prevotella oralis ATCC 33269 Prevotella pallens ATCC 700821 Prevotella timonensis CRIS 5C-B1 Parabacteroides johnsonii DSM 18315 Spirosoma linguale Chlorobium limicola Cetobacterium somerae ATCC BAA-474 Fusobacterium gonidiaformans 3-1-5R Fusobacterium nucleatum subsp. animalis 4_8 Fusobacterium nucleatum subsp. animalis 7_1 Fusobacterium nucleatum subsp. animalis D11 Fusobacterium nucleatum subsp. vincentii 4_1_13 Fusobacterium periodonticum 1_1_41FAA Thermodesulfovibrio yellowstonii Bartonella quintana Beijerinckia indica Bradyrhizobium elkanii Methylobacterium mesophilicum Methylobacterium mesophilicum SR1.6/6 Rhizobium etli Azorhizobium caulinodans Xanthobacter autotrophicus Ehrlichia chaffeensis Rickettsia rickettsii Alcaligenes faecalis Burkholderia cepacia GG4 Lautropia mirabilis Lautropia mirabilis ATCC 51599 Parasutterella excrementihominis YIT 11859 Sutterella parvirubra Sutterella parvirubra YIT 11816 Laribacter hongkongensis Eikenella corrodens Eikenella corrodens ATCC 23834 Kingella oralis Kingella oralis ATCC 51147 Neisseria cinerea ATCC 14685 Neisseria elongata Neisseria elongata subsp. glycolytica ATCC 29315 Neisseria macacae Neisseria macacae ATCC 33926 Neisseria meningitidis Neisseria mucosa ATCC 25996 Neisseria subflava NJ9703 Nitrosospira multiformis Methyloversatilis universalis Methyloversatilis universalis FAM5 Desulfococcus oleovorans Bilophila wadsworthia 3_1_6 Desulfovibrio piger ATCC 29098 Arcobacter butzleri Campylobacter gracilis RM3268 Campylobacter hyointestinalis Campylobacter rectus RM3267 Campylobacter showae CSUNSWCD Campylobacter upsaliensis JV21 Helicobacter bilis ATCC 43879 Helicobacter pullorum MIT 98-5489 Aeromonas caviae Aeromonas media Aeromonas veronii Succinatimonas hippei Succinatimonas hippei YIT 12066 Succinivibrio dextrinosolvens Allochromatium vinosum Cedecea davisae Cedecea davisae DSM 4568 Citrobacter amalonaticus Citrobacter amalonaticus Y19 Citrobacter freundii Citrobacter youngae ATCC 29220 Enterobacter hormaechei Escherichia albertii TW07627 Klebsiella aerogenes Salmonella Salmonella enterica subsp. enterica serovar Typhimurium Trabulsiella guamensis Trabulsiella guamensis ATCC 49490 Tatumella ptyseos Tatumella ptyseos ATCC 33301 Edwardsiella tarda Edwardsiella tarda ATCC 23685 Hafnia alvei Hafnia alvei ATCC 51873 Morganella morganii Morganella morganii subsp. morganii KT Providencia rustigianii DSM 4541 Providencia stuartii ATCC 25827 Serratia marcescens subsp. marcescens Db11 Yersinia enterocolitica Yersinia pestis Yersinia pseudotuberculosis Plesiomonas shigelloides 302-73 Legionella pneumophila Actinobacillus pleuropneumoniae Aggregatibacter aphrophilus Haemophilus haemolyticus Haemophilus sputorum Acinetobacter pittii Acinetobacter haemolyticus Acinetobacter johnsonii Acinetobacter johnsonii SH046 Acinetobacter junii SH205 Francisella tularensis Grimontia hollisae CIP 101886 Vibrio fluvialis Vibrio fluvialis PG41 Vibrio parahaemolyticus Vibrio mimicus Chlamydia trachomatis Leptospira interrogans Acetomicrobium hydrogeniformans Actinomyces graevenitzii C83 Actinomyces naeslundii Actinomyces naeslundii str. Howell 279 Actinomyces urogenitalis DSM 15434 Actinomyces viscosus C505 Mobiluncus curtisii Corynebacterium aurimucosum Corynebacterium durum Corynebacterium durum F0235 Gordonia terrae C-6 Rhodococcus erythropolis Brevibacterium casei S18 Brevibacterium linens Microbacterium oleivorans Kocuria palustris PEL Rothia aeria F0474 Tropheryma whipplei Propionibacterium Streptomyces avermitilis Thermomonospora curvata Collinsella stercoris DSM 13279 Slackia piriformis YIT 12062 Bacillus altitudinis Bacillus infantis NRRL B-14911 Bacillus firmus DS1 Lysinibacillus sphaericus Listeria grayi Listeria grayi DSM 20601 Listeria monocytogenes 10403S Aneurinibacillus aneurinilyticus Aneurinibacillus aneurinilyticus ATCC 12856 Paenibacillus lactis 154 Gemella haemolysans ATCC 10379 Exiguobacterium aurantiacum Abiotrophia defectiva Abiotrophia defectiva ATCC 49176 Enterococcus caccae ATCC BAA-1240 Enterococcus casseliflavus ATCC 12755 Lactobacillus ultunensis DSM 16047 Lactobacillus ruminis ATCC 25644 Lactobacillus antri DSM 16041 Lactobacillus vaginalis DSM 5837 = ATCC 49540 Lactobacillus reuteri CF48-3A Lactobacillus reuteri MM4-1A Pediococcus pentosaceus Lactococcus garvieae Streptococcus constellatus subsp. pharyngis SK1060 = CCUG 46377 Streptococcus australis ATCC 700641 Streptococcus infantis ATCC 700779 Butyricicoccus pullicaecorum Butyricicoccus pullicaecorum 1.2 Clostridium butyricum E4 str. BoNT E BL5262 Clostridium celatum DSM 1785 Clostridium sartagoforme AAU1 Eubacterium ramulus ATCC 29099 Eubacterium ventriosum ATCC 27560 [Eubacterium] cellulosolvens 6 Pseudoramibacter alactolyticus ATCC 23263 Anaerostipes caccae DSM 14662 Blautia hydrogenotrophica DSM 10507 Blautia wexlerae Coprococcus comes ATCC 27758 Dorea longicatena DSM 13814 Clostridium asparagiforme DSM 15981 [Clostridium] bolteae ATCC BAA-613 Clostridium citroniae WAL-17108 [Clostridium] hylemonae DSM 15053 [Clostridium] symbiosum WAL-14163 Lachnospira multipara [Ruminococcus] gnavus ATCC 29149 [Ruminococcus] lactaris ATCC 29176 [Ruminococcus] torques ATCC 27756 Oribacterium sinus F0268 Roseburia inulinivorans DSM 16841 Pseudoflavonifractor capillosus ATCC 29799 Ruminococcus champanellensis [Bacteroides] pectinophilus ATCC 43243 Mogibacterium timidum Mogibacterium timidum ATCC 33093 Eubacterium brachy ATCC 33089 Eubacterium saphenum ATCC 49989 Eggerthia catenaformis OT 569 = DSM 20559 [Clostridium] innocuum 2959 Clostridium spiroforme [Clostridium] spiroforme DSM 1552 Kandleria vitulina Kandleria vitulina DSM 20405 Solobacterium moorei F0204 Parvimonas micra ATCC 33270 Streptomyces coelicolor A3(2) Bordetella pertussis Tohama I Bordetella parapertussis 12822 Ralstonia eutropha H16 Xanthomonas campestris pv. campestris str. ATCC 33913 Xanthomonas campestris pv. campestris str. B100 Xanthomonas campestris pv. campestris str. 8004 Vibrio cholerae M66-2 Vibrio cholerae O1 biovar El Tor str. N16961 Shewanella frigidimarina NCIMB 400 Bacillus cytotoxicus NVH 391-98 Lachnoclostridium phytofermentans ISDg Lactobacillus ruminis ATCC 27782 Leuconostoc citreum KM20 Streptococcus mitis B6 Streptococcus parasanguinis ATCC 15912 Streptococcus parasanguinis FW213 Acidothermus cellulolyticus 11B Alicyclobacillus acidocaldarius subsp. acidocaldarius DSM 446 Alkaliphilus metalliredigens QYMF Alkaliphilus oremlandii OhILAs Amycolatopsis mediterranei U32 Anoxybacillus flavithermus WK1 Arthrobacter aurescens TC1 Bacillus selenitireducens MLS10 Beutenbergia cavernae DSM 12333 Butyrivibrio proteoclasticus B316 Onion yellows phytoplasma OY-M Catenulispora acidiphila DSM 44928 Clavibacter michiganensis subsp. michiganensis NCPPB 382 Clostridium tetani E88 Clostridium novyi NT Clostridium kluyveri DSM 555 Clostridium kluyveri NBRC 12016 Clostridium cellulolyticum H10 Corynebacterium jeikeium K411 Corynebacterium urealyticum DSM 7109 Corynebacterium resistens DSM 45100 Desulfotomaculum reducens MI-1 Exiguobacterium sibiricum 255-15 Exiguobacterium sp. AT1b Frankia alni ACN14a Frankia sp. EuI1c Geobacillus kaustophilus HTA426 Geobacillus thermodenitrificans NG80-2 Gordonia bronchialis DSM 43247 Intrasporangium calvum DSM 43043 Kineococcus radiotolerans SRS30216 Lactobacillus crispatus ST1 Listeria innocua Clip11262 Macrococcus caseolyticus JCSC5402 Mycobacterium leprae TN Mycobacterium bovis AF2122/97 Mycobacterium ulcerans Agy99 Mycobacterium vanbaalenii PYR-1 Mycobacterium bovis BCG str. Pasteur 1173P2 Mycobacterium tuberculosis H37Ra Mycobacterium abscessus ATCC 19977 Mycobacterium leprae Br4923 Mycobacterium sp. Spyr1 Mycobacterium sp. JDM601 Mycobacterium canettii CIPT 140010059 Nakamurella multipartita DSM 44233 Nocardia farcinica IFM 10152 Nocardioides sp. JS614 Oceanobacillus iheyensis HTE831 Aster yellows witches'-broom phytoplasma AYWB Ureaplasma urealyticum serovar 10 str. ATCC 33699 Dictyoglomus turgidum DSM 6724 Bacillus tusciae DSM 2912 Mycoplasma leachii PG50 Pelotomaculum thermopropionicum SI Pseudonocardia dioxanivorans CB1190 Rhodococcus opacus B4 Rhodococcus jostii RHA1 Rhodococcus equi 103S Salinispora tropica CNB-440 Sanguibacter keddieii DSM 10542 Slackia heliotrinireducens DSM 20476 Stackebrandtia nassauensis DSM 44728 Staphylococcus carnosus subsp. carnosus TM300 Streptosporangium roseum DSM 43021 Thermoanaerobacter sp. X514 Thermoanaerobacter pseudethanolicus ATCC 33223 Thermoanaerobacter italicus Ab9 Thermoanaerobacterium thermosaccharolyticum DSM 571 Thermobispora bispora DSM 43833 Thermomonospora curvata DSM 43183 Tsukamurella paurometabola DSM 20162 Ureaplasma parvum serovar 3 str. ATCC 700970 Ureaplasma parvum serovar 3 str. ATCC 27815 Aspergillus nomiae NRRL 13137 Aspergillus novofumigatus Aspergillus novofumigatus IBT 16806 Aspergillus parasiticus SU-1 Aspergillus phoenicis Aspergillus ruber Aspergillus sclerotioniger Aspergillus glaucus Aspergillus aculeatus ATCC 16872 Aspergillus leporis Aspergillus niger ATCC 1015 Aspergillus oryzae RIB40 Aspergillus terreus NIH2624 Aspergillus wentii Aspergillus clavatus NRRL 1 Aspergillus fischeri NRRL 181 Aspergillus fumigatus A1163 Aspergillus fumigatus Af293 Aspergillus calidoustus Aspergillus nidulans FGSC A4 Aspergillus taichungensis Aspergillus tamarii Aspergillus thermomutatus Aspergillus tubingensis Aspergillus violaceofuscus Aspergillus viridinutans Penicillium brasilianum Penicillium brevicompactum Penicillium canescens Penicillium chermesinum Penicillium citrinum Penicillium concentricum Penicillium daleae Penicillium decumbens Penicillium griseofulvum Penicillium hordei Penicillium italicum Penicillium nalgiovense Penicillium oxalicum Penicillium polonicum Penicillium roqueforti FM164 Penicillium solitum Penicillium steckii Penicillium thymicola Penicillium vulpinum Verticillium alfalfae VaMs.102 Trichoderma arundinaceum Trichoderma asperellum Trichoderma atroviride IMI 206040 Trichoderma citrinoviride Trichoderma harzianum Trichoderma longibrachiatum Trichoderma parareesei Trichoderma reesei QM6a Trichoderma virens Trichoderma virens Gv29-8 Fusarium acutatum Fusarium fujikuroi IMI 58289 Fusarium mangiferae Fusarium nygamai Fusarium proliferatum ET1 Fusarium subglutinans Fusarium verticillioides 7600 Fusarium heterosporum Fusarium equiseti Fusarium oxysporum Fo5176 Fusarium oxysporum f. sp. lycopersici 4287 Fusarium austroamericanum Fusarium graminearum PH-1 Fusarium poae Fusarium pseudograminearum CS3096 Fusarium sporotrichioides Fusarium vanettenii Fusarium vanettenii 77-13-4 Fusarium tricinctum Paraburkholderia graminis C4D1M Schaalia cardiffensis F0333 Schaalia odontolytica ATCC 17982 Schaalia turicensis ACS-279-V-Col4 Mycolicibacterium fortuitum subsp. fortuitum DSM 46621 = ATCC 6841 Rhodococcus hoagii ATCC 33707 Acidipropionibacterium acidipropionici ATCC 4875 Anaerobutyricum hallii DSM 3353 Bacteroides helcogenes P 36-108 Bacteroides salanitronis DSM 18170 Klebsiella aerogenes KCTC 2190 Halanaerobium hydrogeniformans Acidiphilium cryptum JF-5 Acidiphilium multivorum AIU301 Acidithiobacillus ferrooxidans ATCC 23270 Acidobacterium capsulatum ATCC 51196 Acidovorax citrulli AAC00-1 Acidovorax sp. JS42 Acidovorax ebreus TPSY Aeromonas salmonicida subsp. salmonicida A449 Agrobacterium vitis S4 Agrobacterium radiobacter K84 Rhodoferax ferrireducens T118 Alcanivorax borkumensis SK2 Alicycliphilus denitrificans K601 Vibrio fischeri MJ11 Aliivibrio salmonicida LFI1238 Alkalilimnicola ehrlichii MLHE-1 Anabaena variabilis ATCC 29413 Anaeromyxobacter dehalogenans 2CP-C Anaeromyxobacter sp. Fw109-5 Anaeromyxobacter sp. K Anaeromyxobacter dehalogenans 2CP-1 Anaplasma phagocytophilum HZ Anaplasma marginale str. Florida Aquifex aeolicus VF5 Arcobacter nitrofigilis DSM 7299 Azorhizobium caulinodans ORS 571 Azotobacter vinelandii DJ Bartonella bacilliformis KC583

Metabolic Reactions

Reactions

This table shows at most 20 reactions. For the full list of associated reactions:

See All Associated Reactions

Reaction ID	Precursor	Product	Enzyme	Reaction Type	Data Source	Reference

Health Effects and Bioactivity

Health Outcome/Bioactivity	Metabolite Response/Effect	Evidence Type	Host and Biospecimen	Data Source	Reference

Microbial Sources

Superkingdom/Kingdom	Phylum	Total species	Hosts and Body Sites	Microbial Links
Eukaryota/Fungi	Ascomycota	1	Human feces; Human saliva	Unknown

Exposure Sources

Other Exposures

Source Type	Data Source	Reference

Host Biospecimen and Location

Host and Biospecimen	Status	Mean	Std	Min	Max	Units	Age	Sex	Health Condition	Data Source	Reference
Human All tissues	Detected but not Quantified						Not Specified	Not Specified	Normal	HMDB	34986597

External Links

HMDB ID

HMDB0013535

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB029535

KNApSAcK ID

Not Available

Chemspider ID

35032713

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

53481853

PDB ID

Not Available

ChEBI ID

Not Available

Food Biomarker Ontology

Not Available

CMMC Knowledgebase

Not Available

General References

Divecha N, Irvine RF: Phospholipid signaling. Cell. 1995 Jan 27;80(2):269-78. doi: 10.1016/0092-8674(95)90409-3. [PubMed:7834746 ]
Simons K, Toomre D: Lipid rafts and signal transduction. Nat Rev Mol Cell Biol. 2000 Oct;1(1):31-9. doi: 10.1038/35036052. [PubMed:11413487 ]
Watson AD: Thematic review series: systems biology approaches to metabolic and cardiovascular disorders. Lipidomics: a global approach to lipid analysis in biological systems. J Lipid Res. 2006 Oct;47(10):2101-11. doi: 10.1194/jlr.R600022-JLR200. Epub 2006 Aug 10. [PubMed:16902246 ]
Sethi JK, Vidal-Puig AJ: Thematic review series: adipocyte biology. Adipose tissue function and plasticity orchestrate nutritional adaptation. J Lipid Res. 2007 Jun;48(6):1253-62. doi: 10.1194/jlr.R700005-JLR200. Epub 2007 Mar 20. [PubMed:17374880 ]
Lingwood D, Simons K: Lipid rafts as a membrane-organizing principle. Science. 2010 Jan 1;327(5961):46-50. doi: 10.1126/science.1174621. [PubMed:20044567 ]
Gunstone, Frank D., John L. Harwood, and Albert J. Dijkstra (2007). The lipid handbook with CD-ROM. CRC Press.
Cevc, Gregor (1993). Phospholipids Handbook. Marcel Dekker.

Showing metabocard for PGP(18:1(9Z)/18:1(11Z)) (MMDBc0046273)

MOL for #<Metabolite:0x000056431d8a5b40>

3D MOL for #<Metabolite:0x000056431d8a5b40>

3D SDF for #<Metabolite:0x000056431d8a5b40>

3D-SDF for #<Metabolite:0x000056431d8a5b40>

PDB for #<Metabolite:0x000056431d8a5b40>

3D PDB for #<Metabolite:0x000056431d8a5b40>

SMILES for #<Metabolite:0x000056431d8a5b40>

INCHI for #<Metabolite:0x000056431d8a5b40>

Structure for #<Metabolite:0x000056431d8a5b40>

3D Structure for #<Metabolite:0x000056431d8a5b40>