Description | Quercetin is a flavonoid widely distributed in many plants and fruits including red grapes, citrus fruit, tomato, broccoli and other leafy green vegetables, and a number of berries, including raspberries and cranberries. In E. coli it is metabolized by Quercetin 2,3-dioxygenase. This enzyme catalyzes the reaction Quercetin + O2 = 2-(3,4-dihydroxybenzoyloxy)-4,6-dihydroxybenzoate + CO + H+. Quercetin is not a normal growth substrate for E. coli but it is found in high levels in the human gut. This enzyme may have evolved to break down quercitin to prevent its inhibition of key E. coli proteins, such as DNA gyrase. |
---|
Structure | OC1=CC(O)=C2C(OC(=C(O)C2=O)C2=CC(O)=C(O)C=C2)=C1 InChI=1S/C15H10O7/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6/h1-5,16-19,21H |
---|
Synonyms | Value | Source |
---|
2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxy-4H-1-benzopyran-4-one | ChEBI | 3,3',4',5,7-Pentahydroxyflavone | ChEBI | 3,5,7,3',4'-Pentahydroxyflavone | ChEBI | Sophoretin | ChEBI | Xanthaurine | ChEBI | 3,3',4,5,7-Pentahydroxyflavone | Kegg | Dikvertin | MeSH | 2-(3,4-Dihydroxy-phenyl)-3,5,7-trihydroxy-chromen-4-one | HMDB | 3',4',5,7-Tetrahydroxyflavan-3-ol | HMDB | 3',4',5,7-Tetrahydroxyflavon-3-ol | HMDB | 3,4',5,5',7-Pentahydroxy-flavone | HMDB | 3,5,7-Trihydroxy-2-(3,4-dihydroxyphenyl)-4H-chromen-4-ON | HMDB | Flavin meletin | HMDB | Meletin | HMDB | Quercetin dihydrate | HMDB | Quercetol | HMDB | Quertin | HMDB | 2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxy-4H-benzopyran-4-one | PhytoBank | 3,3’,4’,5,7-Pentahydroxyflavone | PhytoBank | 3,5,7,3’,4’-Pentahydroxyflavone | PhytoBank | 3,5,7-Trihydroxy-2-(3,4-dihydroxyphenyl)-4H-chromen-4-one | PhytoBank | 3'-Hydroxykaempferol | PhytoBank | 3’-Hydroxykaempferol | PhytoBank | Quercetine | PhytoBank | Quertine | PhytoBank |
|
---|