Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 17:51:08 UTC
Update Date2025-10-07 16:07:50 UTC
Metabolite IDMMDBc0028218
Metabolite Identification
Common NameFusarielin G
DescriptionFusarielin G is a member of the chemical class of metabolites known as fusarielins, which are produced by certain fungi. This compound has a complex chemical structure that features a unique arrangement of carbon, hydrogen, and nitrogen atoms, contributing to its potential bioactivity. Fusarielin G is involved in various biochemical pathways, particularly in the context of fungal metabolism and secondary metabolite production. The biosynthesis of fusarielin G is linked to the metabolic processes of the marine-derived fungus Fusarium graminearum SYSU-MS5127, from which it was isolated alongside other fusarielins (PMID:33293055 ). This indicates its role within the fungal metabolic network, potentially influencing the synthesis of other related compounds and participating in ecological interactions. The intricate chemical structure and the pathways in which fusarielin G is involved highlight its significance in the study of fungal metabolites and their potential applications in biotechnology and pharmacology.
Structure
Synonyms
ValueSource
(2R,3S)-7-[(1AR,2R,3S,3as,7ar,7BS)-2-[(2E)-but-2-en-2-yl]-1a,6-dimethyl-1ah,2H,3H,3ah,4H,7H,7ah,7BH-naphtho[1,2-b]oxiren-3-yl]-3-hydroxy-2,4-dimethylhepta-4,6-dienoateGenerator
Molecular FormulaC25H36O4
Average Mass400.559
Monoisotopic Mass400.261359639
IUPAC Name(2R,3S,4E,6E)-7-[(1aR,2R,3S,3aS,7aR,7bS)-2-[(2E)-but-2-en-2-yl]-1a,6-dimethyl-1aH,2H,3H,3aH,4H,7H,7aH,7bH-naphtho[1,2-b]oxiren-3-yl]-3-hydroxy-2,4-dimethylhepta-4,6-dienoic acid
Traditional Name(2R,3S,4E,6E)-7-[(1aR,2R,3S,3aS,7aR,7bS)-2-[(2E)-but-2-en-2-yl]-1a,6-dimethyl-2H,3H,3aH,4H,7H,7aH,7bH-naphtho[1,2-b]oxiren-3-yl]-3-hydroxy-2,4-dimethylhepta-4,6-dienoic acid
CAS Registry NumberNot Available
SMILES
[H]C(C)=C(C)[C@@]1([H])[C@@]([H])(C([H])=C([H])C(\[H])=C(/C)[C@@]([H])(O)[C@@]([H])(C)C(O)=O)[C@]2([H])CC=C(C)C[C@@]2([H])[C@]2([H])O[C@]12C
InChI Identifier
InChI=1S/C25H36O4/c1-7-15(3)21-19(10-8-9-16(4)22(26)17(5)24(27)28)18-12-11-14(2)13-20(18)23-25(21,6)29-23/h7-11,17-23,26H,12-13H2,1-6H3,(H,27,28)/b10-8-,15-7+,16-9+/t17-,18+,19+,20-,21+,22-,23+,25-/m1/s1
InChI KeyXJOCCPDTMHUETM-QWJYDNQESA-N