Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 10:18:01 UTC
Update Date2025-10-07 16:04:17 UTC
Metabolite IDMMDBc0020307
Metabolite Identification
Common NameEchinocandin B
DescriptionEchinocandin B is a non-ribosomal lipopeptide belonging to the echinocandin class of compounds. Its chemical structure is characterized by a cyclic hexapeptide core linked to a fatty acid side chain, which is crucial for its biological activity. Echinocandin B plays a significant role in the biosynthesis pathways of antifungal agents, particularly as a precursor to anidulafungin, a first-line treatment for systemic and invasive fungal infections (PMID:40415378 ). The production of echinocandin B in Aspergillus nidulans is influenced by various regulatory mechanisms and product inhibition, which complicates its biosynthetic pathway (PMID:41016690 ). Recent studies have utilized genome and transcriptome sequencing to elucidate the mechanisms of echinocandin B biosynthesis, particularly under conditions such as fatty acid feeding (PMID:40352768 ). Furthermore, optimization strategies involving artificial intelligence and response surface methodology have been employed to enhance echinocandin B production in fungal strains (PMID:40415378 ). Overall, understanding the chemistry and biosynthetic pathways of echinocandin B is essential for improving its yield and therapeutic applications in combating fungal infections.
Structure
SynonymsNot Available
Molecular FormulaC52H81N7O16
Average Mass1060.253
Monoisotopic Mass1059.573979556
IUPAC Name(9Z,12Z)-N-[(3S,6S,9S,11R,15S,18S,20R,21R,24S,25S,26S)-6-[(1S,2S)-1,2-dihydroxy-2-(4-hydroxyphenyl)ethyl]-5,8,11,17,20,21,23,25-octahydroxy-3,15-bis[(1R)-1-hydroxyethyl]-26-methyl-2,14-dioxo-1,4,7,13,16,22-hexaazatricyclo[22.3.0.0^{9,13}]heptacosa-4,7,16,22-tetraen-18-yl]octadeca-9,12-dienimidic acid
Traditional Name(9Z,12Z)-N-[(3S,6S,9S,11R,15S,18S,20R,21R,24S,25S,26S)-6-[(1S,2S)-1,2-dihydroxy-2-(4-hydroxyphenyl)ethyl]-5,8,11,17,20,21,23,25-octahydroxy-3,15-bis[(1R)-1-hydroxyethyl]-26-methyl-2,14-dioxo-1,4,7,13,16,22-hexaazatricyclo[22.3.0.0^{9,13}]heptacosa-4,7,16,22-tetraen-18-yl]octadeca-9,12-dienimidic acid
CAS Registry NumberNot Available
SMILES
[H]\C(CCCCC)=C(/[H])C\C([H])=C(\[H])CCCCCCCC(O)=N[C@@]1([H])C[C@@]([H])(O)[C@@]([H])(O)N=C(O)[C@@]2([H])N(C[C@]([H])(C)[C@]2([H])O)C(=O)[C@@]([H])(N=C(O)[C@@]([H])(N=C(O)[C@]2([H])C[C@@]([H])(O)CN2C(=O)[C@@]([H])(N=C1O)[C@@]([H])(C)O)[C@]([H])(O)[C@@]([H])(O)C1=CC=C(O)C=C1)[C@@]([H])(C)O
InChI Identifier
InChI=1S/C52H81N7O16/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-38(65)53-35-26-37(64)48(71)57-50(73)42-43(66)29(2)27-59(42)52(75)40(31(4)61)55-49(72)41(45(68)44(67)32-21-23-33(62)24-22-32)56-47(70)36-25-34(63)28-58(36)51(74)39(30(3)60)54-46(35)69/h9-10,12-13,21-24,29-31,34-37,39-45,48,60-64,66-68,71H,5-8,11,14-20,25-28H2,1-4H3,(H,53,65)(H,54,69)(H,55,72)(H,56,70)(H,57,73)/b10-9-,13-12-/t29-,30+,31+,34+,35-,36-,37+,39-,40-,41-,42-,43-,44-,45-,48+/m0/s1
InChI KeyFAUOJMHVEYMQQG-HVYQDZECSA-N