Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 07:27:10 UTC
Update Date2025-10-07 16:06:36 UTC
Metabolite IDMMDBc0016949
Metabolite Identification
Common NameMacrolactin V
DescriptionMacrolactin V is a polyketide, a class of natural products characterized by their complex structures formed through the condensation of acetyl and propionyl units. This compound exhibits a unique macrolactone structure, which is typical of polyketides, contributing to its diverse biological activities. Chemically, macrolactin V is known to interact with various molecular targets, including glycogen synthase kinase 3 beta (GSK-3β), a key regulator in multiple cellular pathways such as glucose metabolism, cell cycle regulation, and apoptosis. The inhibition of GSK-3β by macrolactin V has been supported by molecular docking studies and steered molecular dynamics simulations, indicating its potential role in modulating signaling pathways associated with these critical biological processes (PMID:40172822 ). This suggests that macrolactin V may influence cellular functions through its interaction with GSK-3β, highlighting its relevance in pharmacological research and potential therapeutic applications.
Structure
SynonymsNot Available
Molecular FormulaC24H34O6
Average Mass418.53
Monoisotopic Mass418.235538815
IUPAC Name(3Z,5Z,8R,9Z,11Z,13R,14R,16R,17Z,19Z,24R)-8,13,14,16-tetrahydroxy-24-methyl-1-oxacyclotetracosa-3,5,9,11,17,19-hexaen-2-one
Traditional Name(3Z,5Z,8R,9Z,11Z,13R,14R,16R,17Z,19Z,24R)-8,13,14,16-tetrahydroxy-24-methyl-1-oxacyclotetracosa-3,5,9,11,17,19-hexaen-2-one
CAS Registry NumberNot Available
SMILES
[H]\C1=C(/[H])\C(\[H])=C([H])/[C@]([H])(O)C[C@@]([H])(O)[C@]([H])(O)\C([H])=C(\[H])/C(/[H])=C([H])\[C@]([H])(O)C\C([H])=C(\[H])/C(/[H])=C([H])\C(=O)O[C@]([H])(C)CCC1
InChI Identifier
InChI=1S/C24H34O6/c1-19-12-6-3-2-4-7-15-21(26)18-23(28)22(27)16-11-10-14-20(25)13-8-5-9-17-24(29)30-19/h2,4-5,7-11,14-17,19-23,25-28H,3,6,12-13,18H2,1H3/b4-2-,8-5-,14-10-,15-7-,16-11-,17-9-/t19-,20-,21+,22-,23-/m1/s1
InChI KeyNRAXHZVAYZPXKQ-BHWGLSPDSA-N